| Company Name: |
Alfa Chemistry |
| Tel: |
+1-5166625404; |
| Email: |
Info@alfa-chemistry.com |
|
| | TAUREMIZINE Basic information |
| Product Name: | TAUREMIZINE | | Synonyms: | TAUREMIZINE;(3S)-3aβ,5,5a,9,9aβ,9bα-Hexahydro-9-hydroxy-3β,5aα,9α-trimethylnaphtho[1,2-b]furan-2,6(3H,4H)-dione;(3S)-3aβ,5,5a,9,9aβ,9bα-Hexahydro-9β-hydroxy-3,5aα,9-trimethylnaphtho[1,2-b]furan-2,6(3H,4H)-dione;Tauremizin;C09600;(3S,3aS,5aR,9R,9aS,9bS)-9-hydroxy-3,5a,9-trimethyl-3a,4,5,5a,9,9a-hexahydronaphtho[1,2-b]furan-2,6(3H,9bH)-dione;Barrelin;Judaicin (eudesmane naphthofuran) | | CAS: | 3162-56-9 | | MF: | C15H20O4 | | MW: | 264.32 | | EINECS: | | | Product Categories: | | | Mol File: | 3162-56-9.mol |  |
| | TAUREMIZINE Chemical Properties |
| Melting point | 240-243 °C | | Boiling point | 449.9±45.0 °C(Predicted) | | density | 1.200±0.06 g/cm3(Predicted) | | storage temp. | -20°C | | pka | 13.15±0.60(Predicted) | | form | solid | | Major Application | metabolomics
vitamins, nutraceuticals, and natural products | | InChI | 1S/C15H20O4/c1-8-9-4-6-14(2)10(16)5-7-15(3,18)12(14)11(9)19-13(8)17/h5,7-9,11-12,18H,4,6H2,1-3H3/t8-,9-,11-,12+,14-,15+/m0/s1 | | InChIKey | NGPDZEACIWDCKX-WUDKWMPASA-N | | SMILES | C[C@H]1[C@@H]2CC[C@]3(C)[C@@H]([C@H]2OC1=O)[C@](C)(O)C=CC3=O |
| Hazard Codes | T | | Risk Statements | 25 | | Safety Statements | 45 | | WGK Germany | 3 | | Storage Class | 6.1C - Combustible acute toxic Cat.3
toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral |
| | TAUREMIZINE Usage And Synthesis |
| Uses | Vulgarin is a sesquiterpene lactone and is used in traditional Chinese medicine in the treatment of hypertension. | | Definition | ChEBI: Vulgarin is a sesquiterpenoid. |
| | TAUREMIZINE Preparation Products And Raw materials |
|