|
|
| | 5-(DIMETHYLAMINO)AMYLAMINE Basic information |
| Product Name: | 5-(DIMETHYLAMINO)AMYLAMINE | | Synonyms: | TIMTEC-BB SBB008565;1-Butanol, 4-(diethylaMino)-;4-(N,N-diethylaMino)-1-butanol;4-(DIETHYLAMINO)BUTANOL-1;4-DIETHYLAMINO-1-BUTANOL;5-(DIMETHYLAMINO)AMYLAMINE;5-(DIMETHYLAMINO)PENTYLAMINE;4-(diethylamino)butan-1-ol | | CAS: | 2683-56-9 | | MF: | C8H19NO | | MW: | 145.24 | | EINECS: | 220-242-2 | | Product Categories: | | | Mol File: | 2683-56-9.mol |  |
| | 5-(DIMETHYLAMINO)AMYLAMINE Chemical Properties |
| Boiling point | 82°C 3mm | | density | 0.9103 g/cm3(Temp: 14 °C) | | storage temp. | 2-8°C, protect from light | | pka | 15.13±0.10(Predicted) | | form | solid | | Appearance | Colorless to light yellow Liquid | | InChI | InChI=1S/C8H19NO/c1-3-9(4-2)7-5-6-8-10/h10H,3-8H2,1-2H3 | | InChIKey | KHYKXDSWXWVQTA-UHFFFAOYSA-N | | SMILES | C(O)CCCN(CC)CC |
| Hazard Codes | C,Xn | | Risk Statements | 36/37/38-41-37/38-22 | | Safety Statements | 26-36/37/39-39 | | RIDADR | 2735 | | WGK Germany | WGK 3 | | HazardClass | CORROSIVE | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral
Eye Dam. 1
Skin Irrit. 2
STOT SE 3 |
| | 5-(DIMETHYLAMINO)AMYLAMINE Usage And Synthesis |
| Uses | 5-(Dimethylamino)amylamine (CAS# 3209-46-9) can be used as a scrubbing solvents for removal of acid gases from fuel gases and synthesis gas. It can also be used to label peptides with tertiary amines and other basic functional groups for improved mass spectrometric analysis. |
| | 5-(DIMETHYLAMINO)AMYLAMINE Preparation Products And Raw materials |
|