|
|
| | 1,1′-Biphenyl, 2-fluoro-4,4′-bis(trans-4-propylcyclohexyl)- Basic information |
| Product Name: | 1,1′-Biphenyl, 2-fluoro-4,4′-bis(trans-4-propylcyclohexyl)- | | Synonyms: | 1,1′-Biphenyl, 2-fluoro-4,4′-bis(trans-4-propylcyclohexyl)-;trans(trans)-2-Fluoro-4,4'-bis(4-n-propylcyclohexyl)-1,1'-biphenyl;2-fluoro-4,4'-bis(trans-4-propylcyclohexyl)-1,1'-Biphenyl;2-Fluoro-4,4'-bis(trans-4-propylcyclohexyl)biphenyl, 97%;2-Fluoro-4,4'-bis((1s,4r)-4-propylcyclohexyl)-1,1'-biphenyl;4,4'-di (trans-4-propyl cyclohexyl)-2-fluorobiphenyl;Propyl cyclohexyl p-propyl cyclohexyl m-fluorobiphenyl;2-fluoro-4-(4-propylcyclohexyl)-1-[4-(4-propylcyclohexyl)phenyl]benzene | | CAS: | 102714-93-2 | | MF: | C30H41F | | MW: | 420.64 | | EINECS: | | | Product Categories: | | | Mol File: | 102714-93-2.mol |  |
| | 1,1′-Biphenyl, 2-fluoro-4,4′-bis(trans-4-propylcyclohexyl)- Chemical Properties |
| Melting point | 130 °C | | Boiling point | 512.1±49.0 °C(Predicted) | | density | 0.979±0.06 g/cm3(Predicted) | | form | powder to crystal | | color | White to Light yellow | | InChI | InChI=1S/C30H41F/c1-3-5-22-7-11-24(12-8-22)25-15-17-27(18-16-25)29-20-19-28(21-30(29)31)26-13-9-23(6-4-2)10-14-26/h15-24,26H,3-14H2,1-2H3/t22-,23-,24-,26- | | InChIKey | SRJLZDPWUSOULH-LWPGTKICSA-N | | SMILES | C1(C2=CC=C([C@@H]3CC[C@@H](CCC)CC3)C=C2)=CC=C([C@@H]2CC[C@@H](CCC)CC2)C=C1F |
| | 1,1′-Biphenyl, 2-fluoro-4,4′-bis(trans-4-propylcyclohexyl)- Usage And Synthesis |
| | 1,1′-Biphenyl, 2-fluoro-4,4′-bis(trans-4-propylcyclohexyl)- Preparation Products And Raw materials |
|