2-chloro-1-ethoxy-ethanimine manufacturers
|
| | 2-chloro-1-ethoxy-ethanimine Basic information |
| Product Name: | 2-chloro-1-ethoxy-ethanimine | | Synonyms: | 2-chloro-1-ethoxy-ethanimine;2-Chloroethanimidic acid ethyl ester hydrochloride;Chloroacetimidic acid ethyl ester hydrochloride;Ethyl 2-chloro-acetimidate HCl;ethyl 2-chloroethanecarboximidate hydrochloride;MFCD10697958;ethyl chloroacetimidate hydrochloride;Ethyl 2-chloroacetimidate hydrochloride | | CAS: | 36743-66-5 | | MF: | C4H8ClNO | | MW: | 0 | | EINECS: | | | Product Categories: | | | Mol File: | 36743-66-5.mol |  |
| | 2-chloro-1-ethoxy-ethanimine Chemical Properties |
| Melting point | 89℃ | | storage temp. | Inert atmosphere,Store in freezer, under -20°C | | Appearance | White to off-white Solid | | InChI | InChI=1S/C4H8ClNO/c1-2-7-4(6)3-5/h6H,2-3H2,1H3 | | InChIKey | VDNWDRKRMWWQFL-UHFFFAOYSA-N | | SMILES | C(=N)(OCC)CCl |
| | 2-chloro-1-ethoxy-ethanimine Usage And Synthesis |
| Uses | Ethyl Chloroacetimidate Hydrochloride is an intermediate in the synthesis of f Phentolamine-d4 Hydrochloride A labelled Phentolamine (P302550) which is an adrenergic blocking agent. An antihypertensive. Used for the treatment of pheochromocytoma. |
| | 2-chloro-1-ethoxy-ethanimine Preparation Products And Raw materials |
|