|
|
| | 1-NAPHTHALENEMETHYLAMINE Basic information |
| | 1-NAPHTHALENEMETHYLAMINE Chemical Properties |
| Melting point | 262-269 °C | | Boiling point | 290-293 °C (lit.) | | density | 1.073 g/mL at 25 °C (lit.) | | refractive index | n20/D 1.643(lit.) | | Fp | >230 °F | | storage temp. | Keep in dark place,Inert atmosphere,2-8°C | | solubility | Miscible with ethanol, ether and carbon disulfide. | | form | Liquid | | pka | 9.06±0.30(Predicted) | | color | Clear light yellow to yellow | | Sensitive | Air Sensitive | | BRN | 2206459 | | InChI | InChI=1S/C11H11N/c12-8-10-6-3-5-9-4-1-2-7-11(9)10/h1-7H,8,12H2 | | InChIKey | NVSYANRBXPURRQ-UHFFFAOYSA-N | | SMILES | C1(CN)=C2C(C=CC=C2)=CC=C1 | | CAS DataBase Reference | 118-31-0(CAS DataBase Reference) | | EPA Substance Registry System | 1-Naphthalenemethanamine (118-31-0) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36/37/39 | | RIDADR | 2735 | | WGK Germany | 3 | | F | 10-34 | | TSCA | TSCA listed | | HazardClass | 8 | | PackingGroup | III | | HS Code | 29214990 |
| | 1-NAPHTHALENEMETHYLAMINE Usage And Synthesis |
| Chemical Properties | Clear light yellow to yellow liquid | | Uses | 1-Naphthalenemethylamine is used to increase the induced circular dichroism (ICD) magnitude exhibited by poly[(4-carboxyphenyl)acetylene]. Further, it reacts with monomethoxypoly(ethylene glycol) succinimido carbonate to prepare carbamate. | | General Description | 1-Naphthylmethylamine increases the induced circular dichroism (ICD) magnitude exhibited by Poly[(4-carboxyphenyl)acetylene]. It forms carbamate by reacting with monomethoxypoly(ethylene glycol) succinimido carbonate (mPEG-SC). |
| | 1-NAPHTHALENEMETHYLAMINE Preparation Products And Raw materials |
|