|
|
| | 2-Bromo-5-nitrothiophene Basic information |
| | 2-Bromo-5-nitrothiophene Chemical Properties |
| Melting point | 44-48 °C (lit.) | | Boiling point | 235-237°C | | density | 1.945±0.06 g/cm3(Predicted) | | Fp | 235-237°C | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | form | solid | | color | Brown | | BRN | 120955 | | InChI | InChI=1S/C4H2BrNO2S/c5-3-1-2-4(9-3)6(7)8/h1-2H | | InChIKey | ZPNFMDYBAQDFDY-UHFFFAOYSA-N | | SMILES | C1(Br)SC([N+]([O-])=O)=CC=1 | | CAS DataBase Reference | 13195-50-1(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | HS Code | 29349990 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 2-Bromo-5-nitrothiophene Usage And Synthesis |
| Chemical Properties | white to light yellow crystal powder | | Uses | 2-Bromo-5-nitrothiophene may be used in the preparation of:
- 3-bromo-4-(5-nitro-2-thienyl)-6-ethoxypyridine
- 5-chloro-2-methoxy-4-(5-nitrothien-2-yl)-pyridine
- 5-(5-nitrothien-2-yl)pyrimidine
- 2-methoxy-5-(5-nitrothien-2-yl)pyrimidine
| | General Description | 2-Bromo-5-nitrothiophene is a heteroaryl halide that can be prepared from thiophene by bromination followed by nitration. It participates in the synthesis of oligothiophene precursors for generating (porphinato)zinc(II)-based chromophores. |
| | 2-Bromo-5-nitrothiophene Preparation Products And Raw materials |
|