|
|
| | (S)-2-((R)-2-Chloropropanamido)-4-carbamoylbutanoic acid Basic information |
| Product Name: | (S)-2-((R)-2-Chloropropanamido)-4-carbamoylbutanoic acid | | Synonyms: | (S)-5-AMino-2-((R)-2-chloropropanaMido)-5-oxopentanoic acid;D-2- - N - acyl -L- glutamine;(2S)-5-amino-2-[[(2R)-2-chloropropanoyl]amino]-5-oxopentanoic acid;N2-[(2R)-2-chloro-1-oxopropyl]-L-Glutamine;((R)-2-chloropropanoyl)-L-glutamine;Alanyl Glutamine Impurity 21;L-Glutamine, N2-[(2R)-2-chloro-1-oxopropyl]-;Alanyl Glutamine Impurity 22 | | CAS: | 159141-33-0 | | MF: | C8H13ClN2O4 | | MW: | 236.65 | | EINECS: | | | Product Categories: | | | Mol File: | 159141-33-0.mol |  |
| | (S)-2-((R)-2-Chloropropanamido)-4-carbamoylbutanoic acid Chemical Properties |
| Boiling point | 600.5±55.0 °C(Predicted) | | density | 1.359±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | pka | 3.09±0.10(Predicted) | | InChI | InChI=1S/C8H13ClN2O4/c1-4(9)7(13)11-5(8(14)15)2-3-6(10)12/h4-5H,2-3H2,1H3,(H2,10,12)(H,11,13)(H,14,15)/t4-,5+/m1/s1 | | InChIKey | JAKFXLPGGKWCLJ-UHNVWZDZSA-N | | SMILES | C(O)(=O)[C@H](CCC(N)=O)NC(=O)[C@H](Cl)C |
| | (S)-2-((R)-2-Chloropropanamido)-4-carbamoylbutanoic acid Usage And Synthesis |
| | (S)-2-((R)-2-Chloropropanamido)-4-carbamoylbutanoic acid Preparation Products And Raw materials |
|