|
|
| | 3-AMINO-1,5-DIMETHYLPYRAZOLE Basic information |
| Product Name: | 3-AMINO-1,5-DIMETHYLPYRAZOLE | | Synonyms: | 3-AMINO-1,5-DIMETHYLPYRAZOLE;3-Amino-1,5-dimethyl-1H-pyrazole;(1,5-dimethylpyrazol-3-yl)amine;1,5-dimethyl-3-pyrazolamine;1,5-dimethylpyrazol-3-amine;1,5-Dimethyl-1H-Pyrazol-3-Ylamine(WX609107) | | CAS: | 35100-92-6 | | MF: | C5H9N3 | | MW: | 111.15 | | EINECS: | 233-305-4 | | Product Categories: | | | Mol File: | 35100-92-6.mol |  |
| | 3-AMINO-1,5-DIMETHYLPYRAZOLE Chemical Properties |
| Melting point | 65-68 ºC | | Boiling point | 235 ºC | | density | 1.17 | | Fp | 96 ºC | | storage temp. | 2-8°C(protect from light) | | form | solid | | pka | 4.17±0.11(Predicted) | | color | yellow | | InChI | InChI=1S/C5H9N3/c1-4-3-5(6)7-8(4)2/h3H,1-2H3,(H2,6,7) | | InChIKey | YGRLFMMSIGPOOI-UHFFFAOYSA-N | | SMILES | N1(C)C(C)=CC(N)=N1 |
| Risk Statements | 20/21/22 | | Safety Statements | 3/9-36/37 | | HazardClass | IRRITANT | | HS Code | 29331990 |
| | 3-AMINO-1,5-DIMETHYLPYRAZOLE Usage And Synthesis |
| Chemical Properties | Yellow solid |
| | 3-AMINO-1,5-DIMETHYLPYRAZOLE Preparation Products And Raw materials |
|