Sodium tauroglycocholate manufacturers
- Sodium tauroglycocholate
-
- $396.00 / 1Kg/Bag
-
2021-11-02
- CAS:41945-48-6
- Min. Order: 1Kg/Bag
- Purity: 99%
- Supply Ability: 2000T
|
| | Sodium tauroglycocholate Basic information |
| Product Name: | Sodium tauroglycocholate | | Synonyms: | SODIUM TAUROGLYCOCHOLATE;sodium N-(N-choloylglycyl)taurinate;SodiumTaurocholateDihydrate~99%;Sodiumtaurocholatedihydrate;2-[[[[(3a,5b,7a,12a)-3,7,12-Trihydroxy-24-oxocholan-24-yl]amino]acetyl]amino]-ethanesulfonic acid monosodium salt;Sodium glycotaurocholate;2-[[[(3α,7α,12α-Trihydroxy-24-oxo-5β-cholan-24-yl)amino]acetyl]amino]ethanesulfonic acid sodium salt;Sodium tauroglycocho | | CAS: | 41945-48-6 | | MF: | C28H47N2NaO8S | | MW: | 594.74 | | EINECS: | 255-596-7 | | Product Categories: | Other APIs | | Mol File: | 41945-48-6.mol |  |
| | Sodium tauroglycocholate Chemical Properties |
| Melting point | >280°C (dec.) | | storage temp. | Store at -20°C | | solubility | DMSO (Slightly), Methanol (Slightly) | | form | Solid | | color | White to Off-White | | InChIKey | PUODKHBECQMSKY-DUFRZVTNNA-M | | SMILES | [Na+].C(S([O-])(=O)=O)CNC(CNC(=O)CC[C@@H](C)[C@@H]1[C@]2([C@@H](O)CC3[C@]4(C)[C@]([H])(C[C@@H](O)C3C2CC1)C[C@H](O)CC4)C)=O |&1:15,17,18,19,23,25,28,35,r| |
| | Sodium tauroglycocholate Usage And Synthesis |
| Uses | Sodium Glycotaurocholate, is an inhibitor of the biliary acid transporting system of the hepatocyte. It’s also used as a surfactant used as a chemical permeation enhancer. |
| | Sodium tauroglycocholate Preparation Products And Raw materials |
|