- Pht-Gly-OH
-
- $0.00/ kg
-
2026-03-13
- CAS:4702-13-0
- Min. Order: 1kg
- Purity: 98%
- Supply Ability: 1T+
- N-Phthaloylglycine
-
- $0.00 / 25kgs/paper drum
-
2026-03-13
- CAS:4702-13-0
- Min. Order: 25kgs/paper drum
- Purity: 99%
- Supply Ability: 10 tons
- N-Phthaloylglycine
-
- $0.00 / 1KG
-
2025-06-27
- CAS:4702-13-0
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 500000kg
|
| | N-Phthaloylglycine Basic information |
| Product Name: | N-Phthaloylglycine | | Synonyms: | 1,3-dihydro-1,3-dioxo-2h-isoindole-2-aceticaci;1,3-DIOXO-2-ISOINDOLINEACETIC ACID;1,3-DIHYDRO-1,3-DIOXO-2H-ISOINDOLEACETIC ACID;AKOS BBS-00005712;AKOS AU36-M177;N-Phthaloyglycine;N-Phthaloylglycine,98+%;2H-Isoindole-2-acetic acid, 1,3-dihydro-1,3-dioxo- | | CAS: | 4702-13-0 | | MF: | C10H7NO4 | | MW: | 205.17 | | EINECS: | 225-177-3 | | Product Categories: | N-Substituted Maleimides, Succinimides & Phthalimides;N-Substituted Phthalimides;API intermediates;Miscellaneous;bc0001 | | Mol File: | 4702-13-0.mol |  |
| | N-Phthaloylglycine Chemical Properties |
| Melting point | 193-196 °C(lit.) | | Boiling point | 343.83°C (rough estimate) | | density | 1.3849 (rough estimate) | | refractive index | 1.5600 (estimate) | | storage temp. | Inert atmosphere,Room Temperature | | solubility | DMSO, Methanol | | form | Solid | | pka | 3.61±0.10(Predicted) | | color | White | | Water Solubility | insoluble | | BRN | 184174 | | InChI | InChI=1S/C10H7NO4/c12-8(13)5-11-9(14)6-3-1-2-4-7(6)10(11)15/h1-4H,5H2,(H,12,13) | | InChIKey | WQINSVOOIJDOLJ-UHFFFAOYSA-N | | SMILES | C1(=O)C2=C(C=CC=C2)C(=O)N1CC(O)=O | | LogP | 0.67 | | CAS DataBase Reference | 4702-13-0(CAS DataBase Reference) |
| Hazard Codes | Xn,Xi | | Risk Statements | 36/37/38-22 | | Safety Statements | 22-24/25-36/37/39-26 | | WGK Germany | 3 | | RTECS | NR3439000 | | HazardClass | IRRITANT | | HS Code | 29251900 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 |
| | N-Phthaloylglycine Usage And Synthesis |
| Chemical Properties | white powder | | Uses | N-Phthaloylglycine (cas# 4702-13-0) is a compound useful in organic synthesis. | | reaction suitability | reaction type: solution phase peptide synthesis |
| | N-Phthaloylglycine Preparation Products And Raw materials |
|