|
|
| | 5,7-Dihydro-indolo[2,3-b]carbazole Basic information |
| Product Name: | 5,7-Dihydro-indolo[2,3-b]carbazole | | Synonyms: | 5,7-DIHYDRO-INDOLO[2,3-B]CARBAZOLE;5H,7H-indolo[2,3-b]carbazole;5,7-Dihydro-indolo[2,3-b]carbazole
(DHIC);Indolo[2,3-b]carbazole, 5,7-dihydro-;5,7-Dihydroindolo[2,3-b]carbazole,96%;1,3-Dihydroindolo[2,3-b ]carbazole | | CAS: | 111296-90-3 | | MF: | C18H12N2 | | MW: | 256.3 | | EINECS: | | | Product Categories: | OLED | | Mol File: | 111296-90-3.mol | ![5,7-Dihydro-indolo[2,3-b]carbazole Structure](CAS/GIF/111296-90-3.gif) |
| | 5,7-Dihydro-indolo[2,3-b]carbazole Chemical Properties |
| Melting point | 348-360℃ | | Boiling point | 569.8±23.0 °C(Predicted) | | density | 1.404±0.06 g/cm3 (20 ºC 760 Torr) | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | pka | 16.70±0.30(Predicted) | | form | Solid | | color | Pale brown to brown | | InChI | InChI=1S/C18H12N2/c1-3-7-15-11(5-1)13-9-14-12-6-2-4-8-16(12)20-18(14)10-17(13)19-15/h1-10,19-20H | | InChIKey | UVHIWKCVGUMHNB-UHFFFAOYSA-N | | SMILES | N1C2=C(C=CC=C2)C2=C1C=C1NC3=C(C1=C2)C=CC=C3 |
| | 5,7-Dihydro-indolo[2,3-b]carbazole Usage And Synthesis |
| Uses | 5,7-Dihydro-indolo[2,3-b]carbazole could be a useful thermally activated delayed fluorescence (TADF) emitter for making efficient OLEDs. | | Synthesis | 4′,6′-Dinitro-1,1′:3′,1′′-terphenyl 27.5 g (86 mmol) in a 1 L reactor,57.8 g (348 mmol) of triphenylphosphine,300 mL of dichlorobenzene was added and the mixture was stirred under reflux for 3 days. After completion of the reaction, dichlorobenzene was removed, and the residue was separated by column chromatography to obtain 10.8 g 5,7-Dihydro-indolo[2,3-b]carbazole (Yield 49.0%) |
| | 5,7-Dihydro-indolo[2,3-b]carbazole Preparation Products And Raw materials |
|