|
|
| | cis-4-Aminocyclohexanecarboxylic acid Basic information |
| | cis-4-Aminocyclohexanecarboxylic acid Chemical Properties |
| Melting point | 299-301 °C(lit.) | | Boiling point | 280.0±33.0 °C(Predicted) | | density | 9 g/cm3 | | storage temp. | Inert atmosphere,Room Temperature | | Water Solubility | Soluble in water | | solubility | Methanol (Very Slightly), Water (Sparingly) | | pka | 4.62±0.25(Predicted) | | form | Powder | | color | Off-white | | Major Application | peptide synthesis | | InChI | InChI=1S/C7H13NO2/c8-6-3-1-5(2-4-6)7(9)10/h5-6H,1-4,8H2,(H,9,10)/t5-,6+ | | InChIKey | DRNGLYHKYPNTEA-OLQVQODUSA-N | | SMILES | [C@@H]1(C(O)=O)CC[C@H](N)CC1 | | CAS DataBase Reference | 3685-23-2(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 29224999 | | Storage Class | 13 - Non Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | cis-4-Aminocyclohexanecarboxylic acid Usage And Synthesis |
| Chemical Properties | off-white powder | | Uses | cis-4-Aminocyclohexanecarboxylic Acid is used as a reagent in the synthesis of thiazolylquinazolines | | Synthesis | The general procedure for the synthesis of 4-aminocyclohexanecarboxylic acid and cis-4-aminocyclohexanecarboxylic acid from p-aminobenzoic acid is as follows: p-aminobenzoic acid (10.0 g, 0.07 mol, 1 eq.), 5% Ru/C catalyst (2.50 g), and 10% NaOH solution (100.0 mL) were added in an autoclave. The mixture was stirred to react under 100 bar hydrogen pressure and 15 bar hydrogen atmosphere. After 20 hours of reaction, the progress of the reaction was detected by thin layer chromatography (TLC), the unfolding agent was dichloromethane/methanol/ammonia (5:5:1, v/v/v), and the staining agent was ninhydrin to confirm that the starting material was completely consumed. Nuclear magnetic resonance (NMR) analysis showed that the reaction was fully converted and the ratio of cis to trans product was 1:4.6. After confirming that the reaction was complete, the reaction was stopped. | | References | [1] European Journal of Medicinal Chemistry, 2001, vol. 36, # 3, p. 265 - 286 [2] Biochemische Zeitschrift, 1933, vol. 262, p. 462 [3] Journal of the American Chemical Society, 1938, vol. 60, p. 2341,2343 [4] Chemische Berichte, 1942, vol. 75, p. 425,428 [5] Chemische Berichte, 1943, vol. 76, p. 1019,1023 |
| | cis-4-Aminocyclohexanecarboxylic acid Preparation Products And Raw materials |
|