|
|
| | O-(4-nitrobenzoyl)hydroxylamine Basic information |
| | O-(4-nitrobenzoyl)hydroxylamine Chemical Properties |
| Melting point | 85.0℃ (decomposition) | | Boiling point | 361.4±44.0 °C(Predicted) | | density | 1.441±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | form | powder to crystal | | pka | -2.68±0.70(Predicted) | | color | White to Light yellow | | BRN | 1966666 | | InChI | InChI=1S/C7H6N2O4/c8-13-7(10)5-1-3-6(4-2-5)9(11)12/h1-4H,8H2 | | InChIKey | VTKRSTQMGNRMHL-UHFFFAOYSA-N | | SMILES | C(ON)(=O)C1=CC=C([N+]([O-])=O)C=C1 |
| Hazard Codes | Xi | | Risk Statements | 43 | | Safety Statements | 36/37 | | WGK Germany | 3 | | HS Code | 2928.00.2500 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Skin Sens. 1 |
| | O-(4-nitrobenzoyl)hydroxylamine Usage And Synthesis |
| Chemical Properties | White to light yellow powder |
| | O-(4-nitrobenzoyl)hydroxylamine Preparation Products And Raw materials |
|