|
|
| | 2,5-Dibromo-4-(trifluoromethyl)pyridine Basic information |
| | 2,5-Dibromo-4-(trifluoromethyl)pyridine Chemical Properties |
| Melting point | 32-34° | | Boiling point | 235.1±35.0 °C(Predicted) | | density | 2.052±0.06 g/cm3(Predicted) | | storage temp. | Storage temp. 2-8°C | | pka | -3.94±0.18(Predicted) | | form | solid | | Appearance | Colorless to light yellow Liquid | | InChI | 1S/C6H2Br2F3N/c7-4-2-12-5(8)1-3(4)6(9,10)11/h1-2H | | InChIKey | JKLDXTVIVWCPBX-UHFFFAOYSA-N | | SMILES | FC(C1=C(Br)C=NC(Br)=C1)(F)F |
| Hazard Codes | Xi,T | | Risk Statements | 25 | | Safety Statements | 45 | | WGK Germany | WGK 3 | | HazardClass | IRRITANT | | HS Code | 2933399990 | | Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral |
| | 2,5-Dibromo-4-(trifluoromethyl)pyridine Usage And Synthesis |
| Uses | 2,5-Dibromo-4-(trifluoromethyl)pyridine is a heterocyclic reagent used in the preparation of complex organic molecules requiring a pyridine moiety. |
| | 2,5-Dibromo-4-(trifluoromethyl)pyridine Preparation Products And Raw materials |
|