| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
marketing1@energy-chemical.com |
|
| | 2,6-Dichloro-3-fluoro-5-(trifluoromethyl)pyridine Basic information |
| | 2,6-Dichloro-3-fluoro-5-(trifluoromethyl)pyridine Chemical Properties |
| Boiling point | 205.3±35.0 °C(Predicted) | | density | 1.621±0.06 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | form | solid | | pka | -5.92±0.10(Predicted) | | InChI | 1S/C6HCl2F4N/c7-4-2(6(10,11)12)1-3(9)5(8)13-4/h1H | | InChIKey | VVXQCTFINCODIF-UHFFFAOYSA-N | | SMILES | ClC1=C(C(F)(F)F)C=C(F)C(Cl)=N1 |
| Hazard Codes | Xi,T | | Risk Statements | 25 | | Safety Statements | 45 | | RIDADR | UN2811 | | WGK Germany | WGK 3 | | HazardClass | IRRITANT | | HS Code | 2933399990 | | Storage Class | 6.1C - Combustible acute toxic Cat.3
toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral |
| | 2,6-Dichloro-3-fluoro-5-(trifluoromethyl)pyridine Usage And Synthesis |
| | 2,6-Dichloro-3-fluoro-5-(trifluoromethyl)pyridine Preparation Products And Raw materials |
|