|
|
| | (1R,2R)-N-Methylsulfonyl-1,2-diphenylethanediamine, 98+% Basic information |
| Product Name: | (1R,2R)-N-Methylsulfonyl-1,2-diphenylethanediamine, 98+% | | Synonyms: | (1R,2R)-N-Methylsulfonyl-1,2-diphenylethanediamine, 98+%;(1R,2R)-N-Methylsulfonyl-1,2-diphenylethanediamine;N-[(1R,2R)-2-Amino-1,2-
diphenylethyl]methanesulfonamide,99%e.e.;N-(1-amino-1,2-diphenylethyl)methanesulfonamide;(R)-N-(1-Amino-1,2-diphenylethyl)methanesulfonamide;Methanesulfonamide, N-[(1R,2R)-2-amino-1,2-diphenylethyl]-;(1R,2R)-N-Methanesulfonyl-1,2-diphenylethylenediamine / R-DPEN Mes;(1R,2R)-(+)-N-Methanesulphonyl-1,2-diphenylethylenediamine | | CAS: | 511534-44-4 | | MF: | C15H18N2O2S | | MW: | 290.38 | | EINECS: | | | Product Categories: | | | Mol File: | 511534-44-4.mol |  |
| | (1R,2R)-N-Methylsulfonyl-1,2-diphenylethanediamine, 98+% Chemical Properties |
| Melting point | 117-119°C | | Boiling point | 453.4±55.0 °C(Predicted) | | density | 1.238±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C, protect from light | | pka | 9.54±0.40(Predicted) | | Appearance | White to light yellow Solid | | InChI | InChI=1S/C15H18N2O2S/c1-20(18,19)17-15(13-10-6-3-7-11-13)14(16)12-8-4-2-5-9-12/h2-11,14-15,17H,16H2,1H3/t14-,15-/m1/s1 | | InChIKey | FSRRNSLQEDUDTP-HUUCEWRRSA-N | | SMILES | CS(N[C@H](C1=CC=CC=C1)[C@H](N)C1=CC=CC=C1)(=O)=O |
| RIDADR | UN3259 | | HazardClass | 8 | | PackingGroup | III |
| | (1R,2R)-N-Methylsulfonyl-1,2-diphenylethanediamine, 98+% Usage And Synthesis |
| | (1R,2R)-N-Methylsulfonyl-1,2-diphenylethanediamine, 98+% Preparation Products And Raw materials |
|