|
|
| | Ethyl 3-anilinobut-2-enoate Basic information |
| Product Name: | Ethyl 3-anilinobut-2-enoate | | Synonyms: | 3-(Phenylamino)-2-butenoicacidethylester;ETHYL (2E)-3-(PHENYLAMINO)BUT-2-ENOATE;Ethyl3-(phenylamino)but-2-enoate;Ethyl-anilinocrotonate;ETHYL 3-ANILINOBUT-2-ENOATE;ETHYL 3-ANILINOCROTONATE;Ethyl -(phenylamino)crotonate;3-Phenylamino-but-2-enoic acid ethyl ester | | CAS: | 6287-35-0 | | MF: | C12H15NO2 | | MW: | 205.25 | | EINECS: | 228-518-4 | | Product Categories: | | | Mol File: | 6287-35-0.mol |  |
| | Ethyl 3-anilinobut-2-enoate Chemical Properties |
| Melting point | 140-143 °C | | Boiling point | 118-119°C 2mm | | density | 1.089±0.06 g/cm3(Predicted) | | refractive index | 1.5770 | | Fp | 118-119°C/2mm | | pka | 0.55±0.70(Predicted) | | BRN | 517336 | | InChI | InChI=1S/C12H15NO2/c1-3-15-12(14)9-10(2)13-11-7-5-4-6-8-11/h4-9,13H,3H2,1-2H3 | | InChIKey | NLGDIRPNWGZGLI-UHFFFAOYSA-N | | SMILES | C(OCC)(=O)C=C(NC1=CC=CC=C1)C | | CAS DataBase Reference | 6287-35-0(CAS DataBase Reference) |
| Safety Statements | 24/25 | | HS Code | 2922210060 |
| Provider | Language |
|
ALFA
| English |
| | Ethyl 3-anilinobut-2-enoate Usage And Synthesis |
| | Ethyl 3-anilinobut-2-enoate Preparation Products And Raw materials |
|