(R,R)-(+)-HYDROBENZOIN manufacturers
- (R,R)-(+)-HYDROBENZOIN
-
- $1.00 / 1g
-
2020-01-13
- CAS:52340-78-0
- Min. Order: 1g
- Purity: 99.0%
- Supply Ability: 100kg
|
| | (R,R)-(+)-HYDROBENZOIN Basic information |
| Product Name: | (R,R)-(+)-HYDROBENZOIN | | Synonyms: | (1R,2R)-(+)-HYDROBENZOIN;(1R,2R)-(+)-1,2-DIPHENYL-1,2-ETHANEDIOL;(R,R)-(+)-HYDROBENZOIN;(R,R)-(+)-1,2-DIPHENYL-1,2-ETHANEDIOL;(R,R)-1,2-DIPHENYL-1,2-ETHANEDIOL;(R,R)-(+)-1,2-DIPHENYLETHANEDIOL;(R,R)-1,2-DIPHENYL-ETHYLENE GLYCOL;(R,R)-(+)-HYDROBENZOIN, 99% (99% EE/HPL& | | CAS: | 52340-78-0 | | MF: | C14H14O2 | | MW: | 214.26 | | EINECS: | | | Product Categories: | | | Mol File: | 52340-78-0.mol |  |
| | (R,R)-(+)-HYDROBENZOIN Chemical Properties |
| Melting point | 146-149 °C(lit.) | | Boiling point | 314.4°C (rough estimate) | | density | 1.0781 (rough estimate) | | refractive index | 95 ° (C=1, CHCl3) | | storage temp. | Sealed in dry,Room Temperature | | solubility | Soluble in DMSO | | pka | 13.38±0.20(Predicted) | | form | Crystalline Powder or Crystals | | color | White to beige or light brown | | Optical Rotation | [α]28/D +93°, c = 2.5 in ethanol | | Merck | 14,4777 | | BRN | 2050815 | | InChI | InChI=1S/C14H14O2/c15-13(11-7-3-1-4-8-11)14(16)12-9-5-2-6-10-12/h1-10,13-16H/t13-,14-/m1/s1 | | InChIKey | IHPDTPWNFBQHEB-ZIAGYGMSSA-N | | SMILES | [C@H](C1=CC=CC=C1)(O)[C@@H](C1=CC=CC=C1)O | | CAS DataBase Reference | 52340-78-0(CAS DataBase Reference) |
| Safety Statements | 22-24/25 | | WGK Germany | 3 | | F | 10 | | HS Code | 29062990 | | Storage Class | 13 - Non Combustible Solids |
| | (R,R)-(+)-HYDROBENZOIN Usage And Synthesis |
| Chemical Properties | white to beige or light brown crystalline powder | | Uses | (R,R)-(+)-Hydrobenzoin may be used in the oxyselenenylation step in the multi-step synthesis of cyclopentitols and aminocyclopentitols from cyclopentene. It may also be used as a ligand for the asymmetric addition of diethylzinc to aldehydes in the presence or absence of titanium tetra-isopropoxide to form (R)- or (S)-form of the corresponding secondary alcohol, respectively. | | Definition | ChEBI: (R,R)-hydrobenzoin is a hydrobenzoin. | | General Description | (R,R)-(+)-Hydrobenzoin is a chiral 1,2-diol useful as a chiral reagent, building block, ligand or auxiliary in asymmetric synthesis. | | IC 50 | Human Endogenous Metabolite |
| | (R,R)-(+)-HYDROBENZOIN Preparation Products And Raw materials |
|