- HEPPSO sodium
-
- $0.00 / 1KG
-
2025-12-31
- CAS:89648-37-3
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 3500kg/month
- HEPPSO sodium
-
- $7.00 / 1kg
-
2019-07-06
- CAS:89648-37-3
- Min. Order: 1kg
- Purity: 99%
- Supply Ability: 100KG
|
| | HEPPSO sodium Basic information |
| Product Name: | HEPPSO sodium | | Synonyms: | N-[2-HYDROXYETHYL]PIPERAZINE-N'-[2-HYDROXYPROPANESULFONIC ACID] SODIUM SALT;HEPPSO sodium;HEPPSO SODIUM SALT;1-Piperazinepropanesulfonic acid, beta-hydroxy-4-(2-hydroxyethyl)- sodium salt;4-(2-Hydroxyethyl)piperazine-1-2-hydroxypropanesulfonic acid sodium salt;N-(Hydroxyethyl)piperazine-N'-2-hydroxypropanesulfonic acid sodium salt;HEPPSO, sodium salt N-(2-Hydroxyethyl)piperazine-N-2-hydroxypropanesulfonic acid, sodium salt;N-(Hydroxyethyl)p | | CAS: | 89648-37-3 | | MF: | C9H19N2NaO5S | | MW: | 290.31 | | EINECS: | 635-882-1 | | Product Categories: | Pharmaceutical Intermediates | | Mol File: | 89648-37-3.mol |  |
| | HEPPSO sodium Chemical Properties |
| storage temp. | Inert atmosphere,Room Temperature | | InChI | InChI=1S/C9H20N2O5S.Na/c12-6-5-10-1-3-11(4-2-10)7-9(13)8-17(14,15)16;/h9,12-13H,1-8H2,(H,14,15,16);/q;+1/p-1 | | InChIKey | YCLWMUYXEGEIGD-UHFFFAOYSA-M | | SMILES | N1(CCN(CCO)CC1)CC(O)CS([O-])(=O)=O.[Na+] | | CAS DataBase Reference | 89648-37-3(CAS DataBase Reference) |
| Hazard Codes | T | | Risk Statements | 25-36/37/38 | | Safety Statements | 26-45 | | RIDADR | UN 2811 6.1/PG 3 | | WGK Germany | 3 | | HS Code | 29335990 |
| | HEPPSO sodium Usage And Synthesis |
| Chemical Properties | White solid | | Uses | HEPPSO (sodium) is a biological buffer. HEPPSO (sodium) is a biomaterial or organic compound that can be used in life science research[1]. | | References | [1] Bergmeyer H U, et al. Biochemical reagents[M]//Methods of Enzymatic Analysis. Academic Press, 1965: 967-1037. |
| | HEPPSO sodium Preparation Products And Raw materials |
|