| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Company Name: |
BePharm Ltd |
| Tel: |
400-685-9117 |
| Email: |
market@bepharm.com |
|
| | 2-(3,5-dimethoxyphenyl)pyrrolidine Basic information |
| | 2-(3,5-dimethoxyphenyl)pyrrolidine Chemical Properties |
| Boiling point | 323℃ | | density | 1.052 | | Fp | 130℃ | | storage temp. | 2-8°C | | pka | 9.44±0.10(Predicted) | | form | solid | | Appearance | Colorless to light yellow Liquid | | InChI | 1S/C12H17NO2/c1-14-10-6-9(7-11(8-10)15-2)12-4-3-5-13-12/h6-8,12-13H,3-5H2,1-2H3 | | InChIKey | SCIDTXFHJJWWTD-UHFFFAOYSA-N | | SMILES | COC1=CC(OC)=CC(C2NCCC2)=C1 |
| WGK Germany | WGK 3 | | Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials | | Hazard Classifications | Acute Tox. 1 Dermal Eye Irrit. 2 Skin Irrit. 2 |
| | 2-(3,5-dimethoxyphenyl)pyrrolidine Usage And Synthesis |
| | 2-(3,5-dimethoxyphenyl)pyrrolidine Preparation Products And Raw materials |
|