|
|
| | 5-(METHOXYMETHYLENE)-2,2-DIMETHYL-1,3-DIOXANE-4,6-DIONE Basic information |
| Product Name: | 5-(METHOXYMETHYLENE)-2,2-DIMETHYL-1,3-DIOXANE-4,6-DIONE | | Synonyms: | 5-(Methoxymethylene)-2,2-dimethyl-1,3-dioxane-4,6-di;5-(Methoxymethylene);5-(METHOXYMETHYLENE)-2,2-DIMETHYL-1,3-DIOXANE-4,6-DIONE;5-(MethoxyMethylidene)-2,2-diMethyl-1,3-dioxane-4,6-dione;1,3-Dioxane-4,6-dione,5-(methoxymethylene)-2,2-dimethyl-;Cabozantinib impurity 56;5-(Methoxymethylene) Meldrum’s Acid;Lenvatinib Impurity 79 | | CAS: | 15568-85-1 | | MF: | C8H10O5 | | MW: | 186.16 | | EINECS: | 1312995-182-4 | | Product Categories: | | | Mol File: | 15568-85-1.mol |  |
| | 5-(METHOXYMETHYLENE)-2,2-DIMETHYL-1,3-DIOXANE-4,6-DIONE Chemical Properties |
| Melting point | 132-134°C | | Boiling point | 390.0±42.0 °C(Predicted) | | density | 1.297±0.06 g/cm3(Predicted) | | storage temp. | Inert atmosphere,Store in freezer, under -20°C | | form | solid | | color | Yellow | | InChI | InChI=1S/C8H10O5/c1-8(2)12-6(9)5(4-11-3)7(10)13-8/h4H,1-3H3 | | InChIKey | DVLSQHLXPRYYRC-UHFFFAOYSA-N | | SMILES | O1C(=O)/C(=C/OC)/C(=O)OC1(C)C |
| HazardClass | IRRITANT | | HS Code | 2932990090 |
| | 5-(METHOXYMETHYLENE)-2,2-DIMETHYL-1,3-DIOXANE-4,6-DIONE Usage And Synthesis |
| Uses | 5-(Methoxymethylene)-2,2-dimethyl-1,3-dioxane-4,6-dione | | References | [1] Synthetic Communications, 1997, vol. 27, # 3, p. 483 - 492 [2] Patent: TWI588139, 2017, B. Location in patent: Paragraph 71; 72 [3] Bioorganic and Medicinal Chemistry Letters, 2016, vol. 26, # 12, p. 2900 - 2906 [4] Tetrahedron, 2002, vol. 58, # 44, p. 9095 - 9100 [5] Bioorganic and Medicinal Chemistry Letters, 2005, vol. 15, # 4, p. 1015 - 1018 |
| | 5-(METHOXYMETHYLENE)-2,2-DIMETHYL-1,3-DIOXANE-4,6-DIONE Preparation Products And Raw materials |
| Raw materials | 2,2-Dimethyl-1,3-dioxane-4,6-dione-->Trimethoxymethane | | Preparation Products | 4-[(2,2-Dimethyl-4,6-dioxo-[1,3]dioxan-5-ylidenemethyl)-amino]-2-methoxy-benzoic acid methyl ester-->5,7-Dimethoxycoumarin-->5-(ANILINOMETHYLENE)-2,2-DIMETHYL-1,3-DIOXANE-4,6-DIONE |
|