|
|
| | Molybdenyl acetylacetonate Basic information |
| | Molybdenyl acetylacetonate Chemical Properties |
| Melting point | 184 °C (dec.) (lit.) | | density | 1,64 g/cm3 | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | form | Powder | | color | Pale yellow | | Specific Gravity | 1.640 | | Water Solubility | 8.52 g/100 mL (20 ºC) | | Sensitive | Air Sensitive | | Hydrolytic Sensitivity | 7: reacts slowly with moisture/water | | Exposure limits | ACGIH: TWA 0.5 mg/m3 NIOSH: IDLH 1000 mg/m3 | | InChI | InChI=1S/2C5H8O2.Mo.2O/c2*1-4(6)3-5(2)7;;;/h2*3,6H,1-2H3;;;/q;;+2;;/p-2/b2*4-3-;;; | | InChIKey | SKMUJBBRXZPAJY-VGKOASNMSA-L | | SMILES | [Mo](=O)(=O)(O/C(/C)=C\C(=O)C)O/C(/C)=C\C(=O)C | | NIST Chemistry Reference | Molybdenyl acetylacetonate(17524-05-9) |
| Hazard Codes | Xn,Xi | | Risk Statements | 20/21/22-36/37/38-40 | | Safety Statements | 23-26-36/37/39-45-24/25 | | WGK Germany | 3 | | TSCA | No | | HS Code | 29144000 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Carc. 2 Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | Molybdenyl acetylacetonate Usage And Synthesis |
| Chemical Properties | light yellow, greyish green to yellow-brown | | Uses | Forms a functional model compound for the study of oxotransferase molybdenum enzymes. Mild catalyst for the deprotection of acetals in high yield. Catalyzes high yield oxidation of secondary alcohols to ketones with sodium percarbonate and phase-transfer catalyst. | | reaction suitability | core: molybdenum reagent type: catalyst |
| | Molybdenyl acetylacetonate Preparation Products And Raw materials |
|