- Bis(4-bromophenyl)amine
-
- $0.00 / 25kg
-
2024-03-28
- CAS:16292-17-4
- Min. Order: 25kg
- Purity: 98%-99%
- Supply Ability: Inquiry
|
| | BIS(4-BROMOPHENYL)AMINE Basic information | | Uses |
| Product Name: | BIS(4-BROMOPHENYL)AMINE | | Synonyms: | 4,4μ-Dibromodiphenylamine, N-phenyl-4,4μ-dibromoaniline;BIS(4-BROMOPHENYL)AMINE;4-bromo-N-(4-bromophenyl)aniline;Double(4-BroMophenyl)aMine;N-phenyl-4,4μ-dibromoaniline;Bis(4-bromophenyl)amine,4,4′-Dibromodiphenylamine, N-phenyl-4,4′-dibromoaniline;BenzenaMine,4-broMo-N-(4-broMophenyl)-;4,4'-Di(bromophenyl)amine | | CAS: | 16292-17-4 | | MF: | C12H9Br2N | | MW: | 327.01 | | EINECS: | 628-026-3 | | Product Categories: | | | Mol File: | 16292-17-4.mol |  |
| | BIS(4-BROMOPHENYL)AMINE Chemical Properties |
| Melting point | 106 °C | | Boiling point | 380.5±27.0 °C(Predicted) | | density | 1.740±0.06 g/cm3(Predicted) | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | solubility | soluble in Methanol | | form | powder to crystal | | pka | -0.55±0.40(Predicted) | | color | White to Almost white | | InChI | InChI=1S/C12H9Br2N/c13-9-1-5-11(6-2-9)15-12-7-3-10(14)4-8-12/h1-8,15H | | InChIKey | VKVHTZNHLOGHGP-UHFFFAOYSA-N | | SMILES | C1(NC2=CC=C(Br)C=C2)=CC=C(Br)C=C1 |
| Hazard Codes | Xn | | Risk Statements | 22-41 | | Safety Statements | 26-36/39 | | WGK Germany | 3 | | HS Code | 29214400 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral
Aquatic Chronic 4
Eye Dam. 1 |
| | BIS(4-BROMOPHENYL)AMINE Usage And Synthesis |
| Uses | Di(4-bromophenyl)amine is an amine organic compound and an important intermediate in the synthesis of pressure-sensitive dyes, pharmaceuticals, rubber, pesticides, and adhesive excipients. | | Chemical Properties | Off-white powder |
| | BIS(4-BROMOPHENYL)AMINE Preparation Products And Raw materials |
|