|
|
| | 4-Androsten-3-one-5-ene-17-carboxylic acid Basic information |
| Product Name: | 4-Androsten-3-one-5-ene-17-carboxylic acid | | Synonyms: | (17-beta)-androst-4-ene-17-carboxylicaci;3-oxo-androst-4-ene-17-beta-carboxylicaci;l552.803;4-ANDROSTEN-3-ONE-17-BETA-CARBOXYLIC ACID;4-Androsten-3-one-5-ene-17-carboxylic acid;4-ANDROSTEN-17BETA-CARBOXYLIC ACID-3-ONE;ANDROST-3-ONE-4-ENE-17BETA-CARBOXYLIC ACID;AD-17-Carboxylic acid | | CAS: | 302-97-6 | | MF: | C20H28O3 | | MW: | 316.43 | | EINECS: | 414-990-0 | | Product Categories: | Organic acids | | Mol File: | 302-97-6.mol |  |
| | 4-Androsten-3-one-5-ene-17-carboxylic acid Chemical Properties |
| Melting point | 260 °C(Solv: acetone (67-64-1); hexane (110-54-3)) | | Boiling point | 483.9±45.0 °C(Predicted) | | density | 1.17±0.1 g/cm3(Predicted) | | solubility | Chloroform (Slightly), Ethanol (Slightly, Sonicated), Methanol (Slightly) | | form | Solid | | pka | 4.81±0.60(Predicted) | | color | White to Off-White | | InChI | InChI=1S/C20H28O3/c1-19-9-7-13(21)11-12(19)3-4-14-15-5-6-17(18(22)23)20(15,2)10-8-16(14)19/h11,14-17H,3-10H2,1-2H3,(H,22,23) | | InChIKey | YQACAXHKQZCEOI-UHFFFAOYSA-N | | SMILES | C1C2(C)C(CCC3C2CCC2(C)C3CCC2C(O)=O)=CC(=O)C1 | | CAS DataBase Reference | 302-97-6(CAS DataBase Reference) |
| | 4-Androsten-3-one-5-ene-17-carboxylic acid Usage And Synthesis |
| Chemical Properties | White to Yellow Solid. | | Uses | 4-Androsten-3-one-5-ene-17-carboxylic acid is a testosterone based deritivative which has been used in the synthesis of a number of biologically active steroids, include finasteride and epristeride. |
| | 4-Androsten-3-one-5-ene-17-carboxylic acid Preparation Products And Raw materials |
|