|
|
| | DELPHIN Basic information |
| Product Name: | DELPHIN | | Synonyms: | DELPHIN;DELPHINIDIN 3,5-DI-O-GLUCOSIDE;DELPHIN CHLORIDE;3,5-Bis(beta-D-glucopyranosyloxy)-7-hydroxy-2-(3,4,5-trihydroxyphenyl)-1-benzopyrylium chloride;Diglucosyl-3,5-delphinidin chloride;Delphinidin-3,5-O-diglucoside chloride;DELPHINIDIN-3,5-DIGLUCOSIDE CHLORIDE(DELPHIN CHLORIDE)(SH);Aurobanin A | | CAS: | 17670-06-3 | | MF: | C27H31ClO17 | | MW: | 662.98 | | EINECS: | | | Product Categories: | Anthocyanins | | Mol File: | 17670-06-3.mol |  |
| | DELPHIN Chemical Properties |
| storage temp. | -20°C | | solubility | Soluble in methan | | form | powder | | color | Dark, reddish | | Major Application | food and beverages | | InChIKey | HKHQPWJHAKAMGC-UHFFFAOYSA-N | | SMILES | [Cl-].[o+]1c2c(c(cc(c2)O)OC5OC(C(C(C5O)O)O)CO)cc(c1c4cc(c(c(c4)O)O)O)OC3OC(C(C(C3O)O)O)CO |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | DELPHIN Usage And Synthesis |
| Uses | Delphinidin 3,5-diglucoside participates in antioxidant and anti-inflammatory activities of target anthocyanins di-glucosides isolated from Syzygium cumini pulp by high speed counter-current chromatography. |
| | DELPHIN Preparation Products And Raw materials |
|