| Company Name: |
Hangzhou J&H Chemical Co., Ltd.
|
| Tel: |
0571-87396432 |
| Email: |
sales@jhechem.com |
| Products Intro: |
Product Name:piperazine-2,2,3,3,5,5,6,6-d8
CAS:134628-42-5
Purity:98% HPLC Package:50KG;10KG;5KG;1KG;500g;100g;10g;1g;
|
| Company Name: |
Clearsynth Canada Inc.
|
| Tel: |
+1.415.685.4395 |
| Email: |
enquiry@clearsynth.com |
| Products Intro: |
Product Name:Piperazine D8
CAS:134628-42-5
Package:1g Remarks:CS-O-30499
|
|
| | PIPERAZINE-2,2,3,3,5,5,6,6-D8 Basic information |
| Product Name: | PIPERAZINE-2,2,3,3,5,5,6,6-D8 | | Synonyms: | Piperazine--d8;PIPERAZINE-2,2,3,3,5,5,6,6-D8;Piperazine D8Q: What is
Piperazine D8 Q: What is the CAS Number of
Piperazine D8 Q: What is the storage condition of
Piperazine D8 Q: What are the applications of
Piperazine D8 | | CAS: | 134628-42-5 | | MF: | C4H10N2 | | MW: | 86.14 | | EINECS: | | | Product Categories: | | | Mol File: | 134628-42-5.mol |  |
| | PIPERAZINE-2,2,3,3,5,5,6,6-D8 Chemical Properties |
| Melting point | 109-119° | | solubility | Water (Slightly) | | form | Solid | | color | White to Off-White | | InChI | InChI=1S/C4H10N2/c1-2-6-4-3-5-1/h5-6H,1-4H2 | | InChIKey | GLUUGHFHXGJENI-UHFFFAOYSA-N | | SMILES | C1([H])([H])NC([H])([H])C([H])([H])NC1([H])[H] |
| RIDADR | UN2579 | | HazardClass | 8 |
| | PIPERAZINE-2,2,3,3,5,5,6,6-D8 Usage And Synthesis |
| Uses | Piperazine D8 can be intended for use as an internal standard for the quantification of Piperazine by GC- or LC-mass spectrometry. | | Uses | Piperazine-2,2,3,3,5,5,6,6-d8 (CAS# 134628-42-5) is a useful isotopically labeled research compound. |
| | PIPERAZINE-2,2,3,3,5,5,6,6-D8 Preparation Products And Raw materials |
|