- 3,3'-Dibromobiphenyl
-
- $200.00 / 1KG
-
2025-09-25
- CAS:16400-51-4
- Min. Order: 1KG
- Purity: 99%, 99.5% Sublimated
- Supply Ability: g-kg-tons, free sample is available
|
| | 1-bromo-3-(3-bromophenyl)benzene Basic information |
| Product Name: | 1-bromo-3-(3-bromophenyl)benzene | | Synonyms: | 1-bromo-3-(3-bromophenyl)benzene;3,3'-Dibromo-1,1'-biphenyl;3,3'-Dibromobiphenyl;3,3'-Dibromodiphenyl;m,m'-Dibromobiphenyl;PBB 11;1,1'-Biphenyl,3,3'-dibroMo-;3,3'-DBB | | CAS: | 16400-51-4 | | MF: | C12H8Br2 | | MW: | 312 | | EINECS: | | | Product Categories: | | | Mol File: | 16400-51-4.mol |  |
| | 1-bromo-3-(3-bromophenyl)benzene Chemical Properties |
| Melting point | 171 °C | | Boiling point | 338.6±17.0 °C(Predicted) | | density | 1.667 | | storage temp. | Sealed in dry,Room Temperature | | Appearance | Off-white to brown Solid | | InChI | InChI=1S/C12H8Br2/c13-11-5-1-3-9(7-11)10-4-2-6-12(14)8-10/h1-8H | | InChIKey | LPLLWKZDMKTEMV-UHFFFAOYSA-N | | SMILES | C1(C2=CC=CC(Br)=C2)=CC=CC(Br)=C1 |
| | 1-bromo-3-(3-bromophenyl)benzene Usage And Synthesis |
| Uses | Unlabeled 3,3'-Dibromodiphenyl-d8 is used in the synthesis of novel aromatic compounds as electroluminescent materials and organic semiconductor materials for organic light emitting devices. |
| | 1-bromo-3-(3-bromophenyl)benzene Preparation Products And Raw materials |
|