|
|
| | 2,6-Dibromo-4-nitroaniline Basic information |
| | 2,6-Dibromo-4-nitroaniline Chemical Properties |
| Melting point | 205-207 °C (lit.) | | Boiling point | 207°C (rough estimate) | | density | 2.2265 (rough estimate) | | refractive index | 1.6220 (estimate) | | storage temp. | 2-8°C, protect from light | | pka | -3.43±0.20(Predicted) | | form | powder to crystal | | color | Light orange to Yellow to Green | | BRN | 2110915 | | Henry's Law Constant | 8.2×103 mol/(m3Pa) at 25℃, Zhang et al. (2010) | | Stability: | Stable. Incompatible with strong oxidizing agents, acids and acid chlorides, chloroformates. | | InChI | InChI=1S/C6H4Br2N2O2/c7-4-1-3(10(11)12)2-5(8)6(4)9/h1-2H,9H2 | | InChIKey | YMZIFDLWYUSZCC-UHFFFAOYSA-N | | SMILES | C1(N)=C(Br)C=C([N+]([O-])=O)C=C1Br | | CAS DataBase Reference | 827-94-1(CAS DataBase Reference) | | EPA Substance Registry System | 2,6-Dibromo-4-nitroaniline (827-94-1) |
| | 2,6-Dibromo-4-nitroaniline Usage And Synthesis |
| Chemical Properties | yellow powder | | Uses | 2,6-Dibromo-4-nitroaniline is an intermediate in the synthesis of PBB 180 (P215190), a brominated biphenyls that can be used as a flame retardant and often incorporated into consumer products including appliances, electronics and plastics. | | Uses | 2,6-Dibromo-4-nitroaniline has been used in the synthesis of:
- blue disperse dyes
- 7-bromo-5-iodo-4-oxo-1,4-dihydroquinoline-2-carboxylic acid
- diphenols-amides such as N-(2,6-dibromo-4-nitrophenyl)-4,4-bis(4-hydroxyphenyl)-pentanamide and N-(2,6-diiodo-4-nitrophenyl)-4,4-bis(4-hydroxyphenyl)-pentanamide
|
| | 2,6-Dibromo-4-nitroaniline Preparation Products And Raw materials |
| Raw materials | 1,3-Dibromo-2,5-dinitrobenzene-->2,4-Dibromo-6-nitroaniline-->1,2,3-TribroMo-5-nitrobenzene-->1,3-DIBROMO-2-METHOXY-5-NITROBENZENE-->2-BROMO-4-NITROANILINE-->2,4,6-Tribromoaniline-->4-NITRO-2-SULFOANILINE-->4-Nitroaniline | | Preparation Products | 3,5-Dibromoaniline-->1,3-DIBROMO-5-IODOBENZENE-->DISPERSE RED 118-->Disperse Orange 61-->Disperse Blue 165:2-->Disperse Blue 165-->Disperse Blue 337-->Disperse Blue 366 |
|