- Diisopropyl D-tartrate
-
- $0.00 / 1Kg
-
2026-02-02
- CAS:62961-64-2
- Min. Order: 1000Kg
- Purity: 98.0%
- Supply Ability: 1kg/month
- Diisopropyl D-tartrate
-
- $60.00 / 1kg
-
2025-06-03
- CAS:62961-64-2
- Min. Order: 10kg
- Purity: 0.99
- Supply Ability: 20tons
|
| | Diisopropyl D-tartrate Basic information |
| Product Name: | Diisopropyl D-tartrate | | Synonyms: | 2,3-dihydroxy-,bis(1-methylethyl)ester,[s-(theta,theta)]-butanedioicaci;Butanedioic acid, 2,3-dihydroxy-, bis(1-methylethyl) ester, [S-(R*,R*)]-;Diisopropyl 2,3-dihydroxysuccinate;(-)-D-TARTARIC ACID DIISOPROPYL ESTER;D-(-)-TARTARIC ACID DIISOPROPYL ESTER;DIPT;DIISOPROPYL (2S,3S)-2,3-DIHYDROXYSUCCINATE;DIISOPROPYL D-(-)-TARTRATE | | CAS: | 62961-64-2 | | MF: | C10H18O6 | | MW: | 234.25 | | EINECS: | 263-771-4 | | Product Categories: | CHIRAL CHEMICALS;Hydroxy Acids & Deriv.;Chiral Compound;Pharmaceutical Intermediates;chiral;Asymmetric Synthesis;Chiral Building Blocks;Esters (Chiral);Synthetic Organic Chemistry;bc0001 | | Mol File: | 62961-64-2.mol |  |
| | Diisopropyl D-tartrate Chemical Properties |
| alpha | -17 º (neat) | | Boiling point | 275 °C | | density | 1.119 g/mL at 20 °C (lit.) | | refractive index | n20/D 1.439(lit.) | | Fp | >230 °F | | storage temp. | Inert atmosphere,Room Temperature | | solubility | Chloroform, Methanol | | pka | 11.70±0.20(Predicted) | | form | Viscous Liquid | | color | Clear colorless | | Optical Rotation | [α]23/D 17°, neat | | Sensitive | Hygroscopic | | BRN | 5265431 | | InChI | 1S/C10H18O6/c1-5(2)15-9(13)7(11)8(12)10(14)16-6(3)4/h5-8,11-12H,1-4H3/t7-,8-/m0/s1 | | InChIKey | XEBCWEDRGPSHQH-YUMQZZPRSA-N | | SMILES | CC(C)OC(=O)[C@@H](O)[C@H](O)C(=O)OC(C)C | | CAS DataBase Reference | 62961-64-2(CAS DataBase Reference) | | NIST Chemistry Reference | Diisopropyl-D-tartrate(62961-64-2) | | EPA Substance Registry System | Butanedioic acid, 2,3-dihydroxy-, bis(1-methylethyl) ester, (2S,3S)- (62961-64-2) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 23-24/25-36-26 | | WGK Germany | 3 | | TSCA | TSCA listed | | HS Code | 29181300 | | Storage Class | 10 - Combustible liquids |
| | Diisopropyl D-tartrate Usage And Synthesis |
| Chemical Properties | Colorless to light yellow liqui | | Uses | Both D- and L-forms are reagents for kinetic resolution of racemic allylic alcohols and α-furfuryl amides by enantioselective epoxidation. |
| | Diisopropyl D-tartrate Preparation Products And Raw materials |
|