- Vitexin-2-O-rhamnoside
-
- $40.00 / 1kg
-
2025-06-20
- CAS:64820-99-1
- Min. Order: 1kg
- Purity: 0.99
- Supply Ability: 10 tons
|
| | Vitexin-2-O-rhamnoside Basic information |
| | Vitexin-2-O-rhamnoside Chemical Properties |
| Melting point | 215°C | | Boiling point | 898.8±65.0 °C(Predicted) | | density | 1.74±0.1 g/cm3(Predicted) | | storage temp. | Inert atmosphere,Room Temperature | | solubility | DMSO (Slightly), Water (Slightly) | | form | Solid | | pka | 6.21±0.40(Predicted) | | color | Light Yellow to Yellow | | Stability: | Unstable in solution | | Major Application | food and beverages | | InChIKey | LYGPBZVKGHHTIE-HUBYJIGHSA-N | | SMILES | C[C@@H]1O[C@@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](CO)O[C@H]2c3c(O)cc(O)c4C(=O)C=C(Oc34)c5ccc(O)cc5)[C@H](O)[C@H](O)[C@H]1O | | LogP | 1.860 (est) |
| WGK Germany | 3 | | F | 10-21 | | HS Code | 29389090 | | Storage Class | 11 - Combustible Solids |
| | Vitexin-2-O-rhamnoside Usage And Synthesis |
| Chemical Properties | Yellow crystalline powder, easily soluble in methanol, derived from hawthorn leaves, a plant of the genus Crataegus in the Rosaceae family. | | Uses | Vitexin-2-O-Rhamnoside is a phenolic glycoside with potential anti-proliferative activity. Anti-obesity agent, adipocyte differentiation inhibitor. | | Definition | ChEBI: A derivative of vitexin having an alpha-L-rhamnosyl residue attached at the 2''-position of the glucitol moiety. |
| | Vitexin-2-O-rhamnoside Preparation Products And Raw materials |
|