|
|
| | 2,5-DIFLUOROPHENYLBORONIC ACID Basic information |
| | 2,5-DIFLUOROPHENYLBORONIC ACID Chemical Properties |
| Melting point | 105-110 °C (lit.) | | Boiling point | 271.3±50.0 °C(Predicted) | | density | 1.35±0.1 g/cm3(Predicted) | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | solubility | soluble in Methanol | | form | Crystalline Powder | | pka | 7.29±0.58(Predicted) | | color | White to light yellow | | BRN | 8833254 | | InChI | InChI=1S/C6H5BF2O2/c8-4-1-2-6(9)5(3-4)7(10)11/h1-3,10-11H | | InChIKey | KTOJGSDLJNUAEP-UHFFFAOYSA-N | | SMILES | B(C1=CC(F)=CC=C1F)(O)O | | CAS DataBase Reference | 193353-34-3(CAS DataBase Reference) |
| Hazard Codes | Xn,Xi | | Risk Statements | 36/37/38-22 | | Safety Statements | 37/39-26-36/37 | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 29319090 | | Storage Class | 11 - Combustible Solids |
| | 2,5-DIFLUOROPHENYLBORONIC ACID Usage And Synthesis |
| Chemical Properties | white to light yellow crystalline powder | | Uses | suzuki reaction | | Uses | 2,5-Difluorophenylboronic acid is a useful reagent for the preparation of potent and selective sphingosine phosphate receptor antagonists that functions as therapeutic agents for the treatment of influenza infections. |
| | 2,5-DIFLUOROPHENYLBORONIC ACID Preparation Products And Raw materials |
|