| Company Name: |
Shangfluoro Gold |
| Tel: |
021-65170832 15601903708 |
| Email: |
qinba_2@163.com |
| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
|
| | Perfluoro-2-butyltetrahydrofuran Basic information |
| | Perfluoro-2-butyltetrahydrofuran Chemical Properties |
| Melting point | -88°C | | Boiling point | 99-107 °C | | density | 1.77 | | refractive index | n20/D 1.296 | | Fp | 99-107°C | | form | liquid | | Specific Gravity | 1.77 | | color | colorless | | Water Solubility | Insoluble | | InChI | InChI=1S/C8F16O/c9-1(10,4(15,16)7(20,21)22)2(11,12)6(19)3(13,14)5(17,18)8(23,24)25-6 | | InChIKey | FYJQJMIEZVMYSD-UHFFFAOYSA-N | | SMILES | O1C(F)(C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)C(F)(F)C(F)(F)C1(F)F | | CAS DataBase Reference | 335-36-4(CAS DataBase Reference) | | EPA Substance Registry System | Furan, 2,2,3,3,4,4,5-heptafluorotetrahydro-5-(nonafluorobutyl)- (335-36-4) |
| Hazard Codes | Xi | | Risk Statements | 53 | | Safety Statements | 61 | | WGK Germany | 3 | | Hazard Note | Irritant | | TSCA | TSCA listed | | HS Code | 29321900 |
| | Perfluoro-2-butyltetrahydrofuran Usage And Synthesis |
| Chemical Properties | clear colourless liquid | | Uses | Perfluoro(2-butyltetrahydrofuran) is used in production of Fluorine-containing polymers. | | Definition | ChEBI: Perfluoro-2-butyltetrahydrofuran is an organofluorine compound and an alkyltetrahydrofuran. |
| | Perfluoro-2-butyltetrahydrofuran Preparation Products And Raw materials |
|