|
|
| | 1,3,4,5-Tetrahydro-2H-1-benzazepin-2-one Basic information |
| Product Name: | 1,3,4,5-Tetrahydro-2H-1-benzazepin-2-one | | Synonyms: | 4,5-DIHYDRO-1-BENZOAZEPIN-2(3H)-ONE;1,3,4,5-TETRAHYDRO-1-BENZAZEPIN-2-ONE;1,3,4,5-TETRAHYDRO-2H-1-BENZAZEPIN-2-ONE;1,3,4,5-TETRAHYDROBENZO[B]AZAPIN-2-ONE;1,3,4,5-TETRAHYDRO-BENZO[B]AZEPIN-2-ONE;TetrahydroBenzazepin-2-One;2H-1-Benzazepin-2-one, 1,3,4,5-tetrahydro-;1,3,4,5-TETRAHYDRO-2H-1-BENZAZEPIN-2-ONE (LACTAM) | | CAS: | 4424-80-0 | | MF: | C10H11NO | | MW: | 161.2 | | EINECS: | | | Product Categories: | pharmacetical;Aromatics Compounds;Aromatics | | Mol File: | 4424-80-0.mol |  |
| | 1,3,4,5-Tetrahydro-2H-1-benzazepin-2-one Chemical Properties |
| Melting point | 143-144 °C | | Boiling point | 339.0±21.0 °C(Predicted) | | density | 1.100±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | solubility | DMSO (Slightly), Methanol (Slightly) | | form | Solid | | pka | 15.13±0.20(Predicted) | | color | Pale Brown | | InChI | InChI=1S/C10H11NO/c12-10-7-3-5-8-4-1-2-6-9(8)11-10/h1-2,4,6H,3,5,7H2,(H,11,12) | | InChIKey | HRVRAYIYXRVAPR-UHFFFAOYSA-N | | SMILES | N1C2=CC=CC=C2CCCC1=O | | CAS DataBase Reference | 4424-80-0(CAS DataBase Reference) |
| | 1,3,4,5-Tetrahydro-2H-1-benzazepin-2-one Usage And Synthesis |
| Chemical Properties | Yellow Oil | | Uses | | | Uses | 4,5-Dihydro-1-benzoazepin-2(3H)-one (cas# 4424-80-0) is a compound useful in organic synthesis. | | Synthesis Reference(s) | Journal of the American Chemical Society, 70, p. 320, 1948 DOI: 10.1021/ja01181a098 |
| | 1,3,4,5-Tetrahydro-2H-1-benzazepin-2-one Preparation Products And Raw materials |
| Preparation Products | 3-Bromo-1,3,4,5-tetrahydro-2H-benzo[b]azepin-2-one-->1H-[1]-BENZAZEPHE-2,5(3H, 4H)-DIONE-->2,3,4,5-Tetrahydro-1H-benzo[b]azepine-->7-(chloroacetyl)-1,3,4,5-tetrahydro-2H-1-benzazepin-2-one-->7-hydroxy-4,5-dihydro-1H-benzo[b]azepin-2(3H)-one |
|