|
|
| | tert-Butyl(triphenylphosphoranylidene)acetate Basic information |
| Product Name: | tert-Butyl(triphenylphosphoranylidene)acetate | | Synonyms: | (tert-ButoxycarbonylMethylene)triphenylphosphorane, 97% 1GR;(tert-ButoxycarbonylMethylene)triphenylphosphorane, 97% 5GR;(tert-ButoxycarbonylMethylene)triphenylphosphorane 98%;Acetic acid, 2-(triphenylphosphoranylidene)-, 1,1-diMethylethyl ester;LABOTEST-BB LT00233234;(TRIPHENYL-LAMBDA5-PHOSPHANYLIDENE)-ACETIC ACID TERT-BUTYL ESTER;(tert-butoxycarbonylmethylene)triphenyl-phosphora;tert-Butyl (triphenylphosphoranylidene)acetate~(Carbo-tert-butoxymethylene)triphenylphosphorane | | CAS: | 35000-38-5 | | MF: | C24H25O2P | | MW: | 376.43 | | EINECS: | 412-880-7 | | Product Categories: | API intermediates | | Mol File: | 35000-38-5.mol |  |
| | tert-Butyl(triphenylphosphoranylidene)acetate Chemical Properties |
| Melting point | 152-155 °C(lit.) | | Boiling point | 503.5±33.0 °C(Predicted) | | density | 1.203(20.0000℃) | | storage temp. | 2-8°C | | solubility | Chloroform (Slightly), Ethyl Acetate (Slightly) | | form | Crystalline Powder | | color | White | | Water Solubility | Sparingly soluble in water. | | BRN | 2759875 | | InChI | InChI=1S/C24H25O2P/c1-24(2,3)26-23(25)19-27(20-13-7-4-8-14-20,21-15-9-5-10-16-21)22-17-11-6-12-18-22/h4-19H,1-3H3 | | InChIKey | ZWZUFQPXYVYAFO-UHFFFAOYSA-N | | SMILES | C(OC(C)(C)C)(=O)C=P(C1=CC=CC=C1)(C1=CC=CC=C1)C1=CC=CC=C1 | | CAS DataBase Reference | 35000-38-5(CAS DataBase Reference) |
| Hazard Codes | T,N | | Risk Statements | 25-36-43-48/22-51/53 | | Safety Statements | 26-36/37/39-45-61 | | RIDADR | UN 3464 6.1/PG 2 | | WGK Germany | 3 | | HazardClass | 6.1 | | PackingGroup | III | | HS Code | 29319090 | | Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral Aquatic Chronic 2 Eye Irrit. 2 Skin Sens. 1 STOT RE 2 |
| | tert-Butyl(triphenylphosphoranylidene)acetate Usage And Synthesis |
| Chemical Properties | white crystalline powder | | Uses | (tert-Butoxycarbonylmethylene)triphenylphosphorane is a chemical used in the synthesis of aldose reductase inhibitors, a podophyllotoxin derivative and tautomycin, a podophyllotoxin derivative and tautomycin. It Is also used in medicinal chemistry. | | Uses | Wittig reagent used in the synthesis of aldose reductase inhibitors, a podophyllotoxin derivative, and tautomycin. Versatile Wittig reagent used in medicinal chemistry. | | Definition | ChEBI: Tert-butyl (triphenylphosphoranylidene)acetate is a phosphine. | | reaction suitability | reaction type: C-C Bond Formation |
| | tert-Butyl(triphenylphosphoranylidene)acetate Preparation Products And Raw materials |
|