|
|
| | Polyinosinic acid Basic information |
| Product Name: | Polyinosinic acid | | Synonyms: | polyinosinicacidpot.salt;POLY[I] POTASSIUM SALT;POLYINOSINIC ACID (5') POTASSIUM SALT;POLYINOSINIC ACID POTASSIUM SALT;POLYINOSINIC ACID TRIPOTASSIUM SALT;POLY RL POTASSIUM SALT;POLYINOSINIC ACID POT. SALT, LYOPH., MR ~1200000;5'-Inosinic acid polymers | | CAS: | 30918-54-8 | | MF: | C10H13N4O8P | | MW: | 348.21 | | EINECS: | 1592732-453-0 | | Product Categories: | Material;Nucleoside Mono | | Mol File: | 30918-54-8.mol |  |
| | Polyinosinic acid Chemical Properties |
| storage temp. | −20°C | | solubility | Methanol (Slightly), Water (Sparingly) | | form | Solid | | color | White to Off-White | | InChI | InChI=1/C10H13N4O8P/c15-6-4(1-21-23(18,19)20)22-10(7(6)16)14-3-13-5-8(14)11-2-12-9(5)17/h2-4,6-7,10,15-16H,1H2,(H,11,12,17)(H2,18,19,20)/t4-,6-,7-,10-/s3 | | InChIKey | GRSZFWQUAKGDAV-BFXIWLNFNA-N | | SMILES | O[C@@H]1[C@@H]([C@@H](COP(O)(O)=O)O[C@H]1N1C=NC2C(NC=NC1=2)=O)O |&1:1,2,3,11,r| |
| | Polyinosinic acid Usage And Synthesis |
| Description | Polyinosinic acid Polycytidylic Acid, Sodium Salt, Double-Stranded is a TLR3 (Toll-like receptor 3) agonist. Known to induce interferon production. Hypochromicity: ≥40% at 248 nm. Extinction coefficient = 5000 M-1cm-1 at 260 nm, pH 7.0. Agent for generation of stable, mature dendritic cells (DC) and immunostimulant. | | Chemical Properties | White or off-white powder, soluble in water, insoluble in organic solvents such as ethanol and acetaminophen. | | Uses | Polyinosinic Acid is an oligolysines used in nucleic acid binding and other biomedical applications. | | Application | Polyinosinic acid (Poly(I)) is a homopolymer of inosine that may be used with polycytidylic acid (poly(C)) to form the double-stranded homopolymer (Poly(I).Poly(C)). TLR3 recognizes double-stranded RNA and is a major effector of the immune response against viral pathogens. (Poly(I).Poly(C)) is a used as a model RNA to study cell signaling at the level of TLR3. Poly(IC) is a TRIF-dependent toll-like receptor-3 (TLR3) ligand. | | benefits |
Polyinosinic acid has antiviral, anti-tumor, lymphocyte immune function enhancement and nucleic acid metabolism inhibition effects.
| | Physiological effects | Polyinosinic acid is a single stranded homonucleic acid, which is a Toll-like Receptor 3 (TLR3) ligand. Polyinosinic acid enhances cellular immune response through TLR3 and TRIF.
|
| | Polyinosinic acid Preparation Products And Raw materials |
|