|
|
| | (S)-(+)-2-Chlorophenylglycine methyl ester Basic information |
| | (S)-(+)-2-Chlorophenylglycine methyl ester Chemical Properties |
| Melting point | 155-158oC | | Boiling point | 270.1±25.0 °C(Predicted) | | density | 1.258±0.06 g/cm3(Predicted) | | storage temp. | Hygroscopic, Refrigerator, under inert atmosphere | | solubility | DMSO (Slightly), Methanol (Slightly) | | form | Solid | | pka | 6.15±0.10(Predicted) | | color | White to Off-White | | InChI | InChI=1/C9H10ClNO2/c1-13-9(12)8(11)6-4-2-3-5-7(6)10/h2-5,8H,11H2,1H3/t8-/s3 | | InChIKey | UTWOZNRDJNWTPS-SBYBRXNCNA-N | | SMILES | C1(C=CC=CC=1Cl)[C@H](N)C(=O)OC |&1:7,r| | | CAS DataBase Reference | 141109-14-0(CAS DataBase Reference) |
| | (S)-(+)-2-Chlorophenylglycine methyl ester Usage And Synthesis |
| Uses | (S)-(+)-2-Chlorophenylglycine methyl ester tartrate |
| | (S)-(+)-2-Chlorophenylglycine methyl ester Preparation Products And Raw materials |
|