|
|
| | RANITIDINE IMPURITY C Basic information |
| Product Name: | RANITIDINE IMPURITY C | | Synonyms: | RANITIDINE IMPURITY C;RANITIDINE-S-OXIDE;RANITIDINE SULPHOXIDE;N-[2-[[[5-[(Dimethyamino)methyl]-2-furanyl]methyl]sulfinyl]ethyl]-Nmethyl-2-nitro-1,1-ethenediamine;1,1-Ethenediamine, N-2-5-(dimethylamino)methyl-2-furanylmethylsulfinylethyl-N-methyl-2-nitro-;Ranitidine Related CoMpound C;Ranitidine Related Compound C (50 mg) (N-[2-[[[5-[(dimethylamino)methyl]-2-furanyl]methyl]sulfinyl]ethyl]-N-methyl-2-nitro-1,1-ethenediamine);Ranitidine EP Impurity C (Ranitidine S-Oxide) | | CAS: | 73851-70-4 | | MF: | C13H22N4O4S | | MW: | 330.4 | | EINECS: | | | Product Categories: | Heterocycles;Sulfur & Selenium Compounds | | Mol File: | 73851-70-4.mol |  |
| | RANITIDINE IMPURITY C Chemical Properties |
| Melting point | 64-67°C | | storage temp. | Hygroscopic, -20°C Freezer, Under Inert Atmosphere | | solubility | Chloroform (Slightly), Methanol (Slightly) | | form | Solid | | color | Light Yellow to Dark Yellow | | BRN | 8395257 | | Stability: | Very Hygroscopic | | Major Application | pharmaceutical (small molecule) | | InChI | InChI=1S/C13H22N4O4S/c1-14-13(9-17(18)19)15-6-7-22(20)10-12-5-4-11(21-12)8-16(2)3/h4-5,9,14-15H,6-8,10H2,1-3H3 | | InChIKey | SKHXRNHSZTXSLP-UHFFFAOYSA-N | | SMILES | C(NCCS(CC1=CC=C(CN(C)C)O1)=O)(NC)=C[N+]([O-])=O |
| Hazard Codes | Xn | | Risk Statements | 37-42/43 | | Safety Statements | 22-36/37 | | WGK Germany | 3 | | HS Code | 2932190002 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Resp. Sens. 1 Skin Sens. 1 STOT SE 3 |
| | RANITIDINE IMPURITY C Usage And Synthesis |
| Uses | Ranitidine S-Oxide (Ranitidine EP Impurity C) is a metabolite of Ranitidine (R120000). | | Definition | ChEBI: Ranitidine-S-oxide is a sulfoxide derivative of the drug ranitidine. It has a role as a marine xenobiotic metabolite and a drug metabolite. It is a member of furans, a tertiary amino compound, a C-nitro compound and a sulfoxide. |
| | RANITIDINE IMPURITY C Preparation Products And Raw materials |
|