| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
6-Methyl-2-p-tolyl-1,3,6,2-dioxazaborocane-4,8-dione manufacturers
|
| | 6-Methyl-2-p-tolyl-1,3,6,2-dioxazaborocane-4,8-dione Basic information |
| Product Name: | 6-Methyl-2-p-tolyl-1,3,6,2-dioxazaborocane-4,8-dione | | Synonyms: | 4-Tolylboronic acid MIDA ester;6-Methyl-2-p-tolyl-1,3,6,2-dioxazaborocane-4,8-dione;2-(4-Methylphenyl)-6-methyl-1,3,6,2-dioxazaborocane-4,8-dione;(T-4)-[N-[(Carboxy-κO)methyl]-N-methylglycinato(2-)-κN,κO](4-methylphenyl)boron;4-methylphenylboronate MIDA ester;4-Methylbenzeneboronic acid MIDA ester;4-Methylbenzeneboronic acid methyliminodiacetic acid ester | | CAS: | 943552-01-0 | | MF: | C12H14BNO4 | | MW: | 247.05486 | | EINECS: | | | Product Categories: | | | Mol File: | 943552-01-0.mol |  |
| | 6-Methyl-2-p-tolyl-1,3,6,2-dioxazaborocane-4,8-dione Chemical Properties |
| Melting point | 197-202 °C | | form | powder | | InChI | 1S/C12H14BNO4/c1-9-3-5-10(6-4-9)13-17-11(15)7-14(2)8-12(16)18-13/h3-6H,7-8H2,1-2H3 | | InChIKey | XXJWDGQXUAQEKD-UHFFFAOYSA-N | | SMILES | CN1CC(=O)OB(OC(=O)C1)c2ccc(C)cc2 |
| WGK Germany | 3 | | HS Code | 2933998090 | | Storage Class | 13 - Non Combustible Solids |
| | 6-Methyl-2-p-tolyl-1,3,6,2-dioxazaborocane-4,8-dione Usage And Synthesis |
| Uses | Suzuki Cross-Coupling with MIDA Boronates | | Synthesis | The reaction was carried out at reflux for 4 hours at 120 °C in a solvent mixture of toluene (45 L) and dimethyl sulfoxide (5 L) (9:1 by volume) using 4-tolueneboronic acid (0.68 kg, 5 mol) and N-methyliminodiacetic acid (MIDA) (0.8 kg, 5.5 mol) as the raw material. After completion of the reaction, it was slowly cooled to room temperature and toluene was removed by rotary evaporation. The residue was diluted with water and subsequently extracted three times with ethyl acetate. The organic phases were combined and washed three times with saturated saline. The organic phase was dried over anhydrous magnesium sulfate, filtered and rotary evaporated to remove the ethyl acetate. The crude product was recrystallized in petroleum ether, filtered to give a pale yellow solid and finally dried under vacuum overnight. |
| | 6-Methyl-2-p-tolyl-1,3,6,2-dioxazaborocane-4,8-dione Preparation Products And Raw materials |
|