| Company Name: |
Merck KGaA |
| Tel: |
21-20338288 |
| Email: |
ordercn@merckgroup.com |
| Company Name: |
SIGMA-RBI |
| Tel: |
800 736 3690 (Orders) |
| Email: |
|
|
| | 3-Hydroxy-4-methoxybenzaldehyde-2,5,6-d3 Basic information |
| | 3-Hydroxy-4-methoxybenzaldehyde-2,5,6-d3 Chemical Properties |
| Melting point | 113-115 °C(lit.) | | InChI | 1S/C8H8O3/c1-11-8-3-2-6(5-9)4-7(8)10/h2-5,10H,1H3/i2D,3D,4D | | InChIKey | JVTZFYYHCGSXJV-NRUYWUNFSA-N | | SMILES | [2H]c1c([2H])c(C=O)c([2H])c(O)c1OC |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36/37 | | WGK Germany | WGK 1 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 3-Hydroxy-4-methoxybenzaldehyde-2,5,6-d3 Usage And Synthesis |
| Uses | - Quality control reference standards - Analytical method development - Chemical synthesis of labeled compounds - reaction mechanism investigations |
| | 3-Hydroxy-4-methoxybenzaldehyde-2,5,6-d3 Preparation Products And Raw materials |
|