|
|
| | 4-Amino-6-hydroxy-2-mercaptopyrimidine monohydrate Basic information |
| | 4-Amino-6-hydroxy-2-mercaptopyrimidine monohydrate Chemical Properties |
| Melting point | >300 °C(lit.) | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | solubility | DMSO (Slightly), Methanol (Slightly, Heated) | | form | Solid | | color | Off-White to Pale Yellow | | Water Solubility | Soluble in water and DMSO. | | BRN | 5795441 | | InChI | InChI=1S/C4H5N3OS.H2O/c5-2-1-3(8)7-4(9)6-2;/h1H,(H4,5,6,7,8,9);1H2 | | InChIKey | BWYGMIYEADAIGW-UHFFFAOYSA-N | | SMILES | NC1NC(=S)NC(=O)C=1.O | | CAS DataBase Reference | 65802-56-4(CAS DataBase Reference) |
| Hazard Codes | Xn | | Risk Statements | 22-36 | | Safety Statements | 26-24/25 | | WGK Germany | 3 | | RTECS | UW0495000 | | TSCA | Yes | | HS Code | 29335990 | | Storage Class | 11 - Combustible Solids |
| | 4-Amino-6-hydroxy-2-mercaptopyrimidine monohydrate Usage And Synthesis |
| Chemical Properties | Off-White Solid | | Uses | Derivatives of 6-Amino-2-thiouracil as novel, potent, and selective A3 adenosine receptor antagonists. | | Uses | 4-Amino-6-hydroxy-2-mercaptopyrimidine is a novel, potent, and selective A3 adenosine receptor antagonists. It is also used as pharmaceutical intermediates. |
| | 4-Amino-6-hydroxy-2-mercaptopyrimidine monohydrate Preparation Products And Raw materials |
|