|
|
| | 1,3-Diphenyl-1,1,3,3-tetramethyldisilazane Basic information |
| Product Name: | 1,3-Diphenyl-1,1,3,3-tetramethyldisilazane | | Synonyms: | 1,3-Diphenyl-1,1,3,3-tetramethyldisilazane, DPTMDS;1,1,3,3-Tetramethyl-1,3-diphenylpropanedisilazane;1,3-Diphenyl-1,1,3,3-tetramethylpropanedisilazane;Bis(dimethylphenylsilyl)amine;Bis(phenyldimethylsilyl)amine;Iminobis(dimethylphenylsilane);Bis(dimethyl(phenyl);1,3-DIPHENYL TETRAMETHYLDISILAZANE 97% | | CAS: | 3449-26-1 | | MF: | C16H23NSi2 | | MW: | 285.53 | | EINECS: | 222-372-5 | | Product Categories: | Pentafluorophenylsilylation, etc. (GC Derivatizing Reagents);Si (Classes of Silicon Compounds);Silazanes;Silylation (GC Derivatizing Reagents);Si-N Compounds;Analytical Chemistry;GC Derivatizing Reagents | | Mol File: | 3449-26-1.mol |  |
| | 1,3-Diphenyl-1,1,3,3-tetramethyldisilazane Chemical Properties |
| Boiling point | 96-100 °C0.1 mm Hg(lit.) | | density | 0.985 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.538(lit.) | | Fp | >230 °F | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | pka | 13.75±0.70(Predicted) | | form | clear liquid | | color | Colorless to Light yellow | | Specific Gravity | 0.985 | | Hydrolytic Sensitivity | 7: reacts slowly with moisture/water | | BRN | 2738118 | | InChI | InChI=1S/C16H23NSi2/c1-18(2,15-11-7-5-8-12-15)17-19(3,4)16-13-9-6-10-14-16/h5-14,17H,1-4H3 | | InChIKey | HIMXYMYMHUAZLW-UHFFFAOYSA-N | | SMILES | [Si](C)(C)(C1=CC=CC=C1)N[Si](C)(C)C1=CC=CC=C1 |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | F | 10-21 | | TSCA | Yes | | HS Code | 29319090 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 1,3-Diphenyl-1,1,3,3-tetramethyldisilazane Usage And Synthesis |
| Uses | 1,1,3,3-Tetramethyl-1,3-diphenyldisilazane can be used:
- As a starting material for the synthesis of its substitution products with the tetrachlorides of silicon and tin.
- To prepare Cu-, Zn- and H2-phthalocyanines using phthalimide.
- As a pre-column deactivation agent prior to the determination of the fatty acids?by GC-MS.
|
| | 1,3-Diphenyl-1,1,3,3-tetramethyldisilazane Preparation Products And Raw materials |
|