|
|
| | 4-Chloro-2-(methylthio)pyrimidine-5-carbonitrile ,97% Basic information | | Uses |
| Product Name: | 4-Chloro-2-(methylthio)pyrimidine-5-carbonitrile ,97% | | Synonyms: | 4-Chloro-2-(methylthio)pyrimidine-5-carbonitrile ,97%;4-Chloro-2-(methylthio)pyrimidine-5-carbonitrile;4-Chloro-2-methylsulfanyl-pyrimidine-5-carbonitrile;4-Chloro-2-methylthio-5-cyanopyrimidine;4-Chloro-2-(methylthio)pyrimidine-5- carbonitrile 97%;4-Chloro-2-(methylsulphanyl)pyrimidine-5-carbonitrile;4-Chloro--2-methylsulfanyl-pyrimididine-5-carbonitrile;4-chloro-2-(methylthio)-5-pyrimidinecarbonitrile | | CAS: | 33089-15-5 | | MF: | C6H4ClN3S | | MW: | 185.63 | | EINECS: | 813-495-0 | | Product Categories: | | | Mol File: | 33089-15-5.mol |  |
| | 4-Chloro-2-(methylthio)pyrimidine-5-carbonitrile ,97% Chemical Properties |
| Melting point | 67-68 °C(Solv: benzene (71-43-2); ligroine (8032-32-4)) | | Boiling point | 340.7±22.0 °C(Predicted) | | density | 1.45±0.1 g/cm3(Predicted) | | storage temp. | Inert atmosphere,Store in freezer, under -20°C | | form | crystals | | pka | -3.26±0.29(Predicted) | | color | Off-white | | InChI | InChI=1S/C6H4ClN3S/c1-11-6-9-3-4(2-8)5(7)10-6/h3H,1H3 | | InChIKey | IGIRTCCCRNZFSQ-UHFFFAOYSA-N | | SMILES | C1(SC)=NC=C(C#N)C(Cl)=N1 |
| | 4-Chloro-2-(methylthio)pyrimidine-5-carbonitrile ,97% Usage And Synthesis |
| Uses | 4-Chloro-2-methylthiopyrimidine-5-onitrile is an organic intermediate. Literature reports that 4-chloro-2-methylthiopyrimidine-5-onitrile can be used to prepare steroidal anti-androgen compounds, and pharmacological experiments have demonstrated that these compounds possess good anti-prostate cancer activity. | | Chemical Properties | White solid | | Synthesis | Dissolve 2 g (6.6 mmol) of ethyl 4-chloro-2-methylthiopyrimidine-5-carboxylate of raw material in 10 ml of anhydrous ethanol, add 0.68 g of NaOH solid, 10 ml of water, and raise the temperature to .
reflux. after 1h TLC showed complete reaction. Spin dry the ethanol and adjust the pH to 3 with 6N HCl, a large amount of solid was precipitated. Filtering yielded 1.69g of white crystals in 91.8% yield. |
| | 4-Chloro-2-(methylthio)pyrimidine-5-carbonitrile ,97% Preparation Products And Raw materials |
|