|
|
| | Chlorodi(p-tolyl)phosphine, 95% Basic information |
| Product Name: | Chlorodi(p-tolyl)phosphine, 95% | | Synonyms: | Chlorodi(p-tolyl)phosphine, 95%;P,P-Bis(4-methylphenyl)-phosphinous chloride, Chlorodi-p-tolylphosphine;chloro-bis(4-methylphenyl)phosphane;Chlorodi(p-tolyl)phosphine;Di-p-tolylchlorophosphine;chlorodi-p-tolylphosphane;orodi(p-toL;Phosphinous chloride, P,P-bis(4-methylphenyl)- | | CAS: | 1019-71-2 | | MF: | C14H14ClP | | MW: | 248.69 | | EINECS: | 202-848-9 | | Product Categories: | | | Mol File: | 1019-71-2.mol |  |
| | Chlorodi(p-tolyl)phosphine, 95% Chemical Properties |
| Boiling point | 180-184℃/10mm | | density | 1.1 g/mL at 25 °C | | refractive index | n20/D1.501 | | storage temp. | 2-8°C | | form | liquid | | Appearance | Colorless to light yellow Viscous Liquid | | Water Solubility | Reacts with water. | | Sensitive | Air & Moisture Sensitive | | InChI | InChI=1S/C14H14ClP/c1-11-3-7-13(8-4-11)16(15)14-9-5-12(2)6-10-14/h3-10H,1-2H3 | | InChIKey | BJBXRRHIBSXGLF-UHFFFAOYSA-N | | SMILES | P(C1=CC=C(C)C=C1)(C1=CC=C(C)C=C1)Cl |
| Hazard Codes | C | | Risk Statements | 14-34 | | Safety Statements | 26-36/37/39-45 | | RIDADR | UN 3265 8 / PGIII | | WGK Germany | 3 | | HazardClass | 8 | | PackingGroup | II | | Storage Class | 8A - Combustible corrosive hazardous materials | | Hazard Classifications | Skin Corr. 1B |
| | Chlorodi(p-tolyl)phosphine, 95% Usage And Synthesis |
| Uses | Chlorodi(p-tolyl)phosphine is used as a reactant for synthesis of palladium catalysts for C-C bond forming cross-coupling reactions, ligands for nickel(0)-catalyzed isomerization reactions, phosphinosulfonamide nickel complexes for oligomerization reactions. It is a reactant for phosphinylation reactions. | | Uses | Reactant for synthesis of:
- Palladium catalysts for C-C bond forming cross-coupling reactions
- Ligands for nickel(0)-catalyzed isomerization reactions
- Phosphinosulfonamide nickel complexes for oligomerization reactions
Reactant for:
- Pd-catalyzed intramolecular asymmetric allylic amination and ring-closing metathesis
- Phosphinylation reactions
| | reaction suitability | reaction type: Buchwald-Hartwig Cross Coupling Reaction
reaction type: Heck Reaction
reaction type: Hiyama Coupling
reaction type: Negishi Coupling
reaction type: Sonogashira Coupling
reaction type: Stille Coupling
reaction type: Suzuki-Miyaura Coupling
reagent type: ligand |
| | Chlorodi(p-tolyl)phosphine, 95% Preparation Products And Raw materials |
|