|
|
| | N-Sulfo-glucosamine sodium salt Basic information | | Uses |
| | N-Sulfo-glucosamine sodium salt Chemical Properties |
| storage temp. | Inert atmosphere,Store in freezer, under -20°C | | solubility | Soluble in DMSO | | InChI | InChI=1/C6H13NO8S.Na.H/c8-1-3(7-16(13,14)15)5(11)6(12)4(10)2-9;;/h1,3-7,9-12H,2H2,(H,13,14,15);;/t3-,4+,5+,6+;;/s3 | | InChIKey | XWFHXUOTHFHRAS-IWNCBHIWNA-N | | SMILES | [C@@H](C=O)(NS(O)(=O)=O)[C@@H](O)[C@H](O)[C@H](O)CO.[NaH] |&1:0,8,10,12,r| | | CAS DataBase Reference | 38899-05-7(CAS DataBase Reference) |
| WGK Germany | 3 | | HS Code | 29329990 |
| | N-Sulfo-glucosamine sodium salt Usage And Synthesis |
| Uses | Sodium glucosamine sulfate, also known as 2-amino-2-deoxy-D-glucose chloride sodium chloride complex salt, is a drug for the treatment and prevention of osteoarthritis. | | Description | N-Sulfo-glucosamine sodium salt is a synthetic, high purity carbohydrate with a custom synthesis. It is an oligosaccharide that is also a sugar and a saccharide. The methylation of it can be achieved by glycosylation or click modification. Click modification is the addition of a carbon atom to the molecule through the reaction with an electrophile, such as N-hydroxysuccinimide ester. This modification can be used to introduce fluorine atoms into the molecules, which can improve their solubility and stability. The product has shown anti-inflammatory activities in animal models, which may be due to its ability to inhibit prostaglandin synthesis. | | Chemical Properties | powder | | Synthesis | Chitin as raw material by concentrated hydrochloric acid hydrolysis, so that the glycosidic bond is broken, amide bond hydrolysis to generate glucosamine hydrochloride, the crude product after refining and sodium sulfate salt, and then use organic precipitant method to get glucosamine sulfate sodium salt. |
| | N-Sulfo-glucosamine sodium salt Preparation Products And Raw materials |
|