|
|
| | (S)-3-Morpholinecarboxylic acid HCl Basic information | | Synthesis Uses |
| | (S)-3-Morpholinecarboxylic acid HCl Chemical Properties |
| Boiling point | 298 ºC | | density | 1.239 | | Fp | 134 ºC | | storage temp. | Store at room temperature | | pka | 2.11±0.20(Predicted) | | Appearance | White to off-white Solid | | InChI | InChI=1S/C5H9NO3/c7-5(8)4-3-9-2-1-6-4/h4,6H,1-3H2,(H,7,8)/t4-/m0/s1 | | InChIKey | JUNOWSHJELIDQP-BYPYZUCNSA-N | | SMILES | N1CCOC[C@H]1C(O)=O |
| Hazard Codes | Xn | | Risk Statements | 20/21/22 | | Safety Statements | 36/37 | | HS Code | 2934999090 |
| | (S)-3-Morpholinecarboxylic acid HCl Usage And Synthesis |
| Synthesis | The target compound (S)-3-MORPHOLINECARBOXYLIC ACID HCL was prepared from oxolysine as the starting material via a cyclization reaction, or from morpholine as the starting material, after preparing an aldehyde-substituted morpholine, followed by an oxidation reaction to obtain (S)-3-MORPHOLINECARBOXYLIC ACID HCL. The synthetic reaction formula is shown in the figure below:  | | Uses | Morpholine compounds are widely found in natural products, possess strong biological activity, and serve as pharmacophores for many drugs. (S)-3-morpholinoic acid is a carboxylic acid compound that can be used as an important pharmaceutical and chemical intermediate. | | Chemical Properties | Class white powder |
| | (S)-3-Morpholinecarboxylic acid HCl Preparation Products And Raw materials |
|