1,2,3-Tribromobenzene manufacturers
|
| | 1,2,3-Tribromobenzene Basic information |
| Product Name: | 1,2,3-Tribromobenzene | | Synonyms: | Benzene, 1,2,3-tribroMo-
1,2,3-TribroMobenzene;Benzene, 1,2,3-tribromo-;Mupirocin Mononer;1,2,3-Tribromobenzene - [T94155];1,2,3-Tribromobenzene | | CAS: | 608-21-9 | | MF: | C6H3Br3 | | MW: | 314.8 | | EINECS: | 200-258-5 | | Product Categories: | pharmacetical | | Mol File: | 608-21-9.mol |  |
| | 1,2,3-Tribromobenzene Chemical Properties |
| Melting point | 89.8℃ | | Boiling point | 271°C (rough estimate) | | density | 2.658 g/cm3 (10 ºC) | | refractive index | 1.6340 (estimate) | | storage temp. | 2-8°C | | solubility | soluble in Toluene | | form | powder to crystal | | color | White to Yellow to Orange | | InChI | InChI=1S/C6H3Br3/c7-4-2-1-3-5(8)6(4)9/h1-3H | | InChIKey | GMVJKSNPLYBFSO-UHFFFAOYSA-N | | SMILES | C1(Br)=CC=CC(Br)=C1Br |
| | 1,2,3-Tribromobenzene Usage And Synthesis |
| Uses | 1,2,3-Tribromobenzene is an organic chemical reagent used in the synthesis of cis-trikentrin B as well as in the synthesis of diphenyl ethers for induction of CYP1A via the receptor mediated pathway. |
| | 1,2,3-Tribromobenzene Preparation Products And Raw materials |
|