|
|
| | TERT-BUTYL DIAZOACETATE Basic information |
| | TERT-BUTYL DIAZOACETATE Chemical Properties |
| Boiling point | 51-53 °C/12 mmHg (lit.) | | density | 1.026 g/mL at 25 °C (lit.) | | refractive index | n20/D 1.453(lit.) | | Fp | 110 °F | | storage temp. | 2-8°C | | solubility | soluble in Chloroform, Methanol | | form | Oil | | color | Clear Yellow | | InChI | InChI=1S/C6H10N2O2/c1-6(2,3)10-5(9)4-8-7/h4H,1-3H3 | | InChIKey | JBVSBLLOZVDAAZ-UHFFFAOYSA-N | | SMILES | C(C)(C)(C)OC(=O)C=[N+]=[N-] |
| | TERT-BUTYL DIAZOACETATE Usage And Synthesis |
| Chemical Properties | Yellow Oil | | Uses | It is a key starting material in the total synthesis of manzacidin A. It can also be used in the synthesis of diastero- and enantioselective synthesis of 2-vinylcyclopropa[b]indolines from 2-vinylindoles. | | Uses | New Diazoacetate Formulations | | Uses | An intermediate in the production of Zolpidem metabolites | | General Description | tert-Butyl diazoacetate can be used for numerous organic transformations, including cyclopropanation, insertion, and aziridine-forming reactions. |
| | TERT-BUTYL DIAZOACETATE Preparation Products And Raw materials |
|