|
|
| | 2-(2,5-Dimethyl-pyrrol-1-yl)-3-phenyl-propionic acid Basic information |
| | 2-(2,5-Dimethyl-pyrrol-1-yl)-3-phenyl-propionic acid Chemical Properties |
| Boiling point | 409.8±45.0 °C(Predicted) | | density | 1.10±0.1 g/cm3(Predicted) | | pka | 2.59±0.10(Predicted) | | form | solid | | InChI | 1S/C15H17NO2/c1-11-8-9-12(2)16(11)14(15(17)18)10-13-6-4-3-5-7-13/h3-9,14H,10H2,1-2H3,(H,17,18) | | InChIKey | CIUPYBFUPLMRLH-UHFFFAOYSA-N | | SMILES | Cc1ccc(C)n1C(Cc2ccccc2)C(O)=O |
| Hazard Codes | Xi,Xn | | Risk Statements | 22 | | WGK Germany | WGK 3 | | HazardClass | IRRITANT | | Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral |
| | 2-(2,5-Dimethyl-pyrrol-1-yl)-3-phenyl-propionic acid Usage And Synthesis |
| | 2-(2,5-Dimethyl-pyrrol-1-yl)-3-phenyl-propionic acid Preparation Products And Raw materials |
|