|
|
| | BIS(4-METHOXYPHENYL) DISULPHIDE Basic information |
| | BIS(4-METHOXYPHENYL) DISULPHIDE Chemical Properties |
| Melting point | 41-45 °C(lit.) | | Boiling point | 200°C 3mm | | density | 1.139 g/cm3(Temp: 100.5 °C) | | Fp | >230 °F | | storage temp. | Sealed in dry,Room Temperature | | form | Fused solid | | Appearance | White to off-white Solid | | BRN | 1914789 | | InChI | 1S/C14H14O2S2/c1-15-11-3-7-13(8-4-11)17-18-14-9-5-12(16-2)6-10-14/h3-10H,1-2H3 | | InChIKey | PZQGLCGLPMWYBT-UHFFFAOYSA-N | | SMILES | COc1ccc(SSc2ccc(OC)cc2)cc1 | | CAS DataBase Reference | 5335-87-5(CAS DataBase Reference) |
| Hazard Codes | Xi,N | | Risk Statements | 41-50/53-36 | | Safety Statements | 60-61-26 | | RIDADR | UN 3077 9/PG 3 | | WGK Germany | 3 | | Hazard Note | Irritant | | HS Code | 29309090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Aquatic Acute 1 Aquatic Chronic 1 Eye Dam. 1 |
| | BIS(4-METHOXYPHENYL) DISULPHIDE Usage And Synthesis |
| Chemical Properties | Yellow crystalline low melting powder and chunks |
| | BIS(4-METHOXYPHENYL) DISULPHIDE Preparation Products And Raw materials |
|