|
|
| | 2,3,4,6-Tetraacetyl-D-glucose Basic information |
| Product Name: | 2,3,4,6-Tetraacetyl-D-glucose | | Synonyms: | 2,3,4,6-TETRA-O-ACETYL-D-GLUCOPYRANOSE;2,3,4,6-O-Tetraacetyl-D-glucose;2,3,4,6-Tetraacetyl-D-glucose;acetic acid (3,4,5-triacetyloxy-6-hydroxy-2-oxanyl)methyl ester;z061D-Glucopyranose, 2,3,4,6-tetraacetate;D-Glucopyranose, 2,3,4,6-tetraacetate;2,3,4,6-Tetraacetate D-Glucopyranose;2,3,4,6-Tetraacetyl- | | CAS: | 10343-06-3 | | MF: | C14H20O10 | | MW: | 348.3 | | EINECS: | 1312995-182-4 | | Product Categories: | Carbohydrates & Derivatives | | Mol File: | 10343-06-3.mol |  |
| | 2,3,4,6-Tetraacetyl-D-glucose Chemical Properties |
| Melting point | 118-120°C | | Boiling point | 425.0±45.0 °C(Predicted) | | density | 1.33±0.1 g/cm3(Predicted) | | storage temp. | Sealed in dry,2-8°C | | solubility | Soluble in chloroform or ethyl acetate | | pka | 11.44±0.70(Predicted) | | form | Powder | | color | White to Off-white | | Stability: | Hygroscopic | | InChI | InChI=1S/C14H20O10/c1-6(15)20-5-10-11(21-7(2)16)12(22-8(3)17)13(14(19)24-10)23-9(4)18/h10-14,19H,5H2,1-4H3/t10-,11-,12+,13-,14/m1/s1 | | InChIKey | IEOLRPPTIGNUNP-RQICVUQASA-N | | SMILES | OC1O[C@H](COC(=O)C)[C@@H](OC(=O)C)[C@H](OC(=O)C)[C@H]1OC(=O)C |
| | 2,3,4,6-Tetraacetyl-D-glucose Usage And Synthesis |
| Chemical Properties | White Crystalline Solid | | Uses | 2,3,4,6-Tetra-O-acetyl-D-glucopyranose (cas# 10343-06-3) is a compound useful in organic synthesis. |
| | 2,3,4,6-Tetraacetyl-D-glucose Preparation Products And Raw materials |
|